The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
diethyl-hydroxy-[4-[(5-methyl-3-phenyl-isoxazole-4-carbonyl)amino]phenyl]ammonium 3-chlorobenzoate ID: ALA4542352
PubChem CID: 155551240
Max Phase: Preclinical
Molecular Formula: C28H28ClN3O5
Molecular Weight: 522.00
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[N+](O)(CC)c1ccc(NC(=O)c2c(-c3ccccc3)noc2C)cc1.O=C([O-])c1cccc(Cl)c1
Standard InChI: InChI=1S/C21H23N3O3.C7H5ClO2/c1-4-24(26,5-2)18-13-11-17(12-14-18)22-21(25)19-15(3)27-23-20(19)16-9-7-6-8-10-16;8-6-3-1-2-5(4-6)7(9)10/h6-14,26H,4-5H2,1-3H3;1-4H,(H,9,10)
Standard InChI Key: SZXMVFYSQZYOGE-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
19.9624 -10.6149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6762 -10.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3903 -10.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3903 -11.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6788 -11.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9624 -11.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2486 -11.8609 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.6762 -9.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9624 -8.9673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3942 -8.9673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1116 -10.5604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4450 -10.0755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6969 -9.2871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5221 -9.2871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7782 -10.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5759 -10.2891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9369 -8.5739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5221 -7.8606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7623 -8.5739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1729 -7.8606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7625 -7.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1723 -6.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9981 -6.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4119 -7.1447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0034 -7.8606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4129 -5.7202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2341 -5.7202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6151 -5.5066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4015 -4.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6224 -4.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0424 -4.3385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2863 -8.5739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4608 -8.5735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0487 -7.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4637 -7.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2833 -7.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6995 -7.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
2 8 1 0
8 9 2 0
8 10 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 11 1 0
15 16 1 0
14 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
21 20 2 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 2 0
20 25 1 0
23 26 1 0
26 27 1 0
26 28 1 0
28 29 1 0
26 30 1 0
30 31 1 0
32 13 1 0
33 32 2 0
34 33 1 0
35 34 2 0
36 35 1 0
37 36 2 0
32 37 1 0
M CHG 2 10 -1 26 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.00Molecular Weight (Monoisotopic): 521.1717AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. Jumppanen M, Kinnunen SM, Välimäki MJ, Talman V, Auno S, Bruun T, Boije Af Gennäs G, Xhaard H, Aumüller IB, Ruskoaho H, Yli-Kauhaluoma J.. (2019) Synthesis, Identification, and Structure-Activity Relationship Analysis of GATA4 and NKX2-5 Protein-Protein Interaction Modulators., 62 (17): [PMID:31431011 ] [10.1021/acs.jmedchem.9b01086 ]