The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-N4-(4-deuterio-2-isopropylsulfonyl-phenyl)-N2-[2-isopropoxy-5-methyl-4-(4-piperidyl)phenyl]pyrimidine-2,4-diamine ID: ALA4542506
PubChem CID: 155551637
Max Phase: Preclinical
Molecular Formula: C28H36ClN5O3S
Molecular Weight: 558.15
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: [2H]c1ccc(Nc2nc(Nc3cc(C)c(C4CCNCC4)cc3OC(C)C)ncc2Cl)c(S(=O)(=O)C(C)C)c1
Standard InChI: InChI=1S/C28H36ClN5O3S/c1-17(2)37-25-15-21(20-10-12-30-13-11-20)19(5)14-24(25)33-28-31-16-22(29)27(34-28)32-23-8-6-7-9-26(23)38(35,36)18(3)4/h6-9,14-18,20,30H,10-13H2,1-5H3,(H2,31,32,33,34)/i7D
Standard InChI Key: VERWOWGGCGHDQE-WHRKIXHSSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
44.2604 -2.8024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.6731 -3.5123 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
45.0815 -2.7999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.7314 -3.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7303 -4.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4383 -5.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1480 -4.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1451 -3.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4365 -3.5326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4381 -5.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7290 -6.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7269 -7.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4327 -7.6156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.1423 -7.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1461 -6.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8563 -5.1680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4341 -2.7154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.1406 -2.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8474 -2.7136 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.5534 -2.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5514 -1.4855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8375 -1.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1344 -1.4915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.2621 -2.7104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.2573 -1.0738 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
43.2642 -3.5276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5564 -3.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5581 -4.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2674 -5.1565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9764 -4.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9712 -3.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3866 -3.9153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0904 -3.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3943 -4.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0236 -3.5330 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.3160 -3.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3162 -4.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6082 -3.5334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2705 -5.9737 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 10 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
7 16 1 0
9 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
20 24 1 0
21 25 1 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
31 2 1 0
2 32 1 0
32 33 1 0
32 34 1 0
4 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
29 39 1 0
M ISO 1 39 2
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.15Molecular Weight (Monoisotopic): 557.2227AlogP: 6.36#Rotatable Bonds: 9Polar Surface Area: 105.24Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.58CX Basic pKa: 10.07CX LogP: 5.81CX LogD: 3.38Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: -1.18
References 1. Das D, Wang J, Li Y, Shi J, Hong J.. (2019) Design, synthesis of orally bioavailable novel anaplastic lymphoma kinase (ALK) inhibitor diphenylaminopyrimidine analogs and efficacy study on NCI-H2228 xenografts mice model., 29 (12): [PMID:31005443 ] [10.1016/j.bmcl.2019.04.012 ]