2-[(2-Ethyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene)-hydrazono]-3-(4-hydroxyphenyl)-4-methyl-2,3-dihydrothiazole-5-carboxylic acid ethyl ester

ID: ALA4542841

PubChem CID: 155551996

Max Phase: Preclinical

Molecular Formula: C26H24N6O3S2

Molecular Weight: 532.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1s/c(=N\N=C\c2c(-c3ccccc3)nc3sc(CC)nn23)n(-c2ccc(O)cc2)c1C

Standard InChI:  InChI=1S/C26H24N6O3S2/c1-4-21-30-32-20(22(28-25(32)36-21)17-9-7-6-8-10-17)15-27-29-26-31(18-11-13-19(33)14-12-18)16(3)23(37-26)24(34)35-5-2/h6-15,33H,4-5H2,1-3H3/b27-15+,29-26-

Standard InChI Key:  DKVBHYQCIFIYPB-FQVPYNAUSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   21.0763  -26.0017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0580  -24.6587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5854  -25.3371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8517  -24.9039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8608  -25.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6517  -25.9824    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.1330  -25.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6368  -24.6405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7619  -25.3496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3363  -24.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5088  -24.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1059  -25.3711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5323  -26.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3584  -26.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7915  -23.8746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9787  -23.7153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7123  -22.9313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9039  -22.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5576  -22.0255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7392  -22.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5786  -22.9311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2979  -23.3334    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.9568  -21.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7821  -21.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1834  -20.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7608  -19.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9326  -19.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5348  -20.6024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1614  -19.1552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1795  -21.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8303  -23.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1571  -22.8010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7552  -24.0972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4087  -23.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7355  -22.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9571  -25.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3770  -26.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  2  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  3  9  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 19 23  1  0
 26 29  1  0
 20 30  1  0
 21 31  1  0
 31 32  1  0
 31 33  2  0
 32 34  1  0
 34 35  1  0
  7 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4542841

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 532.65Molecular Weight (Monoisotopic): 532.1351AlogP: 5.00#Rotatable Bonds: 7
Polar Surface Area: 106.37Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.88CX Basic pKa: 1.96CX LogP: 6.08CX LogD: 6.07
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.18Np Likeness Score: -1.51

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source