The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[(2-Ethyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene)-hydrazono]-3-(4-hydroxyphenyl)-4-methyl-2,3-dihydrothiazole-5-carboxylic acid ethyl ester ID: ALA4542841
PubChem CID: 155551996
Max Phase: Preclinical
Molecular Formula: C26H24N6O3S2
Molecular Weight: 532.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1s/c(=N\N=C\c2c(-c3ccccc3)nc3sc(CC)nn23)n(-c2ccc(O)cc2)c1C
Standard InChI: InChI=1S/C26H24N6O3S2/c1-4-21-30-32-20(22(28-25(32)36-21)17-9-7-6-8-10-17)15-27-29-26-31(18-11-13-19(33)14-12-18)16(3)23(37-26)24(34)35-5-2/h6-15,33H,4-5H2,1-3H3/b27-15+,29-26-
Standard InChI Key: DKVBHYQCIFIYPB-FQVPYNAUSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
21.0763 -26.0017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0580 -24.6587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5854 -25.3371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8517 -24.9039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8608 -25.7323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6517 -25.9824 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.1330 -25.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6368 -24.6405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7619 -25.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3363 -24.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5088 -24.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1059 -25.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5323 -26.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3584 -26.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7915 -23.8746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9787 -23.7153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7123 -22.9313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9039 -22.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5576 -22.0255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7392 -22.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5786 -22.9311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2979 -23.3334 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.9568 -21.3064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7821 -21.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1834 -20.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7608 -19.8681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9326 -19.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5348 -20.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1614 -19.1552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1795 -21.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8303 -23.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1571 -22.8010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7552 -24.0972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4087 -23.1463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7355 -22.6709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9571 -25.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3770 -26.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
3 9 1 0
2 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
19 23 1 0
26 29 1 0
20 30 1 0
21 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
7 36 1 0
36 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.65Molecular Weight (Monoisotopic): 532.1351AlogP: 5.00#Rotatable Bonds: 7Polar Surface Area: 106.37Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.88CX Basic pKa: 1.96CX LogP: 6.08CX LogD: 6.07Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.18Np Likeness Score: -1.51
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]