kalmitoxin-I

ID: ALA454312

PubChem CID: 44559353

Max Phase: Preclinical

Molecular Formula: C20H34O7

Molecular Weight: 386.49

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Synonyms: Kalmitoxin I | Kalmitoxin I|CHEMBL454312|NS00093899

Canonical SMILES:  CC1(C)[C@@H](O)C[C@H]2[C@](C)(O)[C@@H]3CC[C@@H]4[C@@H](O)[C@]3(C[C@@]4(C)O)[C@H](O)[C@@H](O)[C@@]21O

Standard InChI:  InChI=1S/C20H34O7/c1-16(2)12(21)7-11-18(4,26)10-6-5-9-13(22)19(10,8-17(9,3)25)14(23)15(24)20(11,16)27/h9-15,21-27H,5-8H2,1-4H3/t9-,10+,11+,12+,13-,14-,15-,17-,18-,19-,20+/m1/s1

Standard InChI Key:  HRJZZHMMTOORSG-BPYSUHJDSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    6.5249    1.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0978   -0.3739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9257   -0.3813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5871    0.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7815    1.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7584    0.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2689    1.0594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4467    0.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2240    0.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8319    0.5634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6583    1.3627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8748    1.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6590   -0.5397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0442   -0.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8392   -0.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9312    2.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9597    0.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7524   -0.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7770    1.9109    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2689    1.8850    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.5496    0.9741    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4419    0.9840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0790    1.5160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7248   -1.1308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3409   -1.1039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6259    1.1862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4325   -0.7899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0385   -1.0673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1056    2.1486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1696   -0.4318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  5  1  0
  5 23  1  0
 22  6  1  0
  6  4  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  8 13  1  1
 10 14  1  0
 13 14  1  0
 14 15  1  1
  1 16  1  1
  6 17  1  0
  6 18  1  0
  5 19  1  6
  7 20  1  1
 10 21  1  6
 23 22  1  0
  2 24  1  1
  3 25  1  6
  5  1  1  0
 22 26  1  1
  1  7  1  0
  4  2  1  0
  8  3  1  0
  2  3  1  0
 14 28  1  0
  9 27  1  1
  1 29  1  0
  4 30  1  1
M  END

Alternative Forms

  1. Parent:

    ALA454312

    KALMITOXIN I

Associated Targets(non-human)

Lymantria dispar (12 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 386.49Molecular Weight (Monoisotopic): 386.2305AlogP: -0.86#Rotatable Bonds:
Polar Surface Area: 141.61Molecular Species: NEUTRALHBA: 7HBD: 7
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 7#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.66CX Basic pKa: CX LogP: -2.13CX LogD: -2.13
Aromatic Rings: Heavy Atoms: 27QED Weighted: 0.29Np Likeness Score: 2.85

References

1. El-Naggar SF, Doskotch RW, ODell TM, Girard L.  (1980)  Antifeedant Diterpenes For the Gypsy Moth Larvae From Kalmia latifolia: Isolation and Characterization of Ten Grayanoids,  43  (5): [10.1021/np50011a016]

Source