The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-methyl 2-(benzyloxycarbonylamino)-3-octanamidopropanoate ID: ALA4543170
PubChem CID: 155551835
Max Phase: Preclinical
Molecular Formula: C20H30N2O5
Molecular Weight: 378.47
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC(=O)NC[C@H](NC(=O)OCc1ccccc1)C(=O)OC
Standard InChI: InChI=1S/C20H30N2O5/c1-3-4-5-6-10-13-18(23)21-14-17(19(24)26-2)22-20(25)27-15-16-11-8-7-9-12-16/h7-9,11-12,17H,3-6,10,13-15H2,1-2H3,(H,21,23)(H,22,25)/t17-/m0/s1
Standard InChI Key: BFWBOYRRPUREAB-KRWDZBQOSA-N
Molfile:
RDKit 2D
27 27 0 0 0 0 0 0 0 0999 V2000
5.9001 -5.9709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6145 -5.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6145 -4.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3290 -4.3208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3290 -3.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6145 -3.0833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1855 -5.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4710 -5.9709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1855 -4.7333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7566 -5.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0421 -5.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3284 -5.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6144 -5.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6139 -6.7927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3334 -7.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0444 -6.7909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0435 -3.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0435 -2.2584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7579 -1.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7579 -1.0209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4724 -0.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1869 -1.0209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9013 -0.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3290 -5.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3290 -6.7959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0435 -5.5583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7579 -5.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 1
3 4 1 0
4 5 1 0
5 6 2 0
1 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
5 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
2 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 378.47Molecular Weight (Monoisotopic): 378.2155AlogP: 2.93#Rotatable Bonds: 12Polar Surface Area: 93.73Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.27CX Basic pKa: ┄CX LogP: 3.32CX LogD: 3.32Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.43Np Likeness Score: -0.30
References 1. (2012) Small molecule inhibitors of ghrelin O-acyltransferase,