(S)-methyl 2-(benzyloxycarbonylamino)-3-octanamidopropanoate

ID: ALA4543170

PubChem CID: 155551835

Max Phase: Preclinical

Molecular Formula: C20H30N2O5

Molecular Weight: 378.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCC(=O)NC[C@H](NC(=O)OCc1ccccc1)C(=O)OC

Standard InChI:  InChI=1S/C20H30N2O5/c1-3-4-5-6-10-13-18(23)21-14-17(19(24)26-2)22-20(25)27-15-16-11-8-7-9-12-16/h7-9,11-12,17H,3-6,10,13-15H2,1-2H3,(H,21,23)(H,22,25)/t17-/m0/s1

Standard InChI Key:  BFWBOYRRPUREAB-KRWDZBQOSA-N

Molfile:  

 
     RDKit          2D

 27 27  0  0  0  0  0  0  0  0999 V2000
    5.9001   -5.9709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6145   -5.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6145   -4.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3290   -4.3208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3290   -3.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6145   -3.0833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1855   -5.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4710   -5.9709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1855   -4.7333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7566   -5.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0421   -5.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3284   -5.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6144   -5.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6139   -6.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3334   -7.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0444   -6.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0435   -3.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0435   -2.2584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7579   -1.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7579   -1.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4724   -0.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1869   -1.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9013   -0.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3290   -5.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3290   -6.7959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0435   -5.5583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7579   -5.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  1
  3  4  1  0
  4  5  1  0
  5  6  2  0
  1  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  5 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
  2 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4543170

    ---

Associated Targets(non-human)

Mboat4 Ghrelin O-acyltransferase (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.47Molecular Weight (Monoisotopic): 378.2155AlogP: 2.93#Rotatable Bonds: 12
Polar Surface Area: 93.73Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.27CX Basic pKa: CX LogP: 3.32CX LogD: 3.32
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.43Np Likeness Score: -0.30

References

1.  (2012)  Small molecule inhibitors of ghrelin O-acyltransferase, 

Source