The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(Ethane-1,2-diyl)bis(4-nitrobenzamide) ID: ALA4543507
Cas Number: 33288-81-2
PubChem CID: 2134211
Max Phase: Preclinical
Molecular Formula: C16H14N4O6
Molecular Weight: 358.31
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCNC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C16H14N4O6/c21-15(11-1-5-13(6-2-11)19(23)24)17-9-10-18-16(22)12-3-7-14(8-4-12)20(25)26/h1-8H,9-10H2,(H,17,21)(H,18,22)
Standard InChI Key: KGDGPIKXAQPEMP-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
34.0111 -18.3744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0099 -19.1939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7180 -19.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4276 -19.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4248 -18.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7162 -17.9655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3019 -19.6020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5945 -19.1928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3013 -20.4191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1310 -17.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8402 -18.3655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1279 -17.1423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5464 -17.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2556 -18.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9618 -17.9489 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6710 -18.3548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3772 -17.9435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6741 -19.1720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.0836 -18.3516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7893 -17.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7866 -17.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0724 -16.7172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3697 -17.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4923 -16.7108 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.2020 -17.1157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.4881 -15.8936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
7 9 2 0
5 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 17 1 0
21 24 1 0
24 25 1 0
24 26 2 0
M CHG 4 7 1 8 -1 24 1 25 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 358.31Molecular Weight (Monoisotopic): 358.0913AlogP: 1.66#Rotatable Bonds: 7Polar Surface Area: 144.48Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.39CX Basic pKa: ┄CX LogP: 1.80CX LogD: 1.80Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.44Np Likeness Score: -0.90
References 1. Güngör T, Önder FC, Tokay E, Gülhan ÜG, Hacıoğlu N, Tok TT, Çelik A, Köçkar F, Ay M.. (2019) PRODRUGS FOR NITROREDUCTASE BASED CANCER THERAPY- 2: Novel amide/Ntr combinations targeting PC3 cancer cells., 171 [PMID:30928710 ] [10.1016/j.ejmech.2019.03.035 ]