The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-hydroxy-N-(4-(4-(3-(hydroxyamino)-3-oxoprop-1-enyl)-2-methoxyphenoxy)butyl)benzamide ID: ALA4543731
PubChem CID: 155552399
Max Phase: Preclinical
Molecular Formula: C21H24N2O6
Molecular Weight: 400.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)NO)ccc1OCCCCNC(=O)c1ccccc1O
Standard InChI: InChI=1S/C21H24N2O6/c1-28-19-14-15(9-11-20(25)23-27)8-10-18(19)29-13-5-4-12-22-21(26)16-6-2-3-7-17(16)24/h2-3,6-11,14,24,27H,4-5,12-13H2,1H3,(H,22,26)(H,23,25)/b11-9+
Standard InChI Key: YPCZEOCJBRBCLX-PKNBQFBNSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
35.0346 -2.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0335 -3.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7415 -3.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4512 -3.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4484 -2.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7397 -2.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3255 -3.8896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3268 -2.2536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3266 -1.4364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1545 -2.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8638 -2.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5699 -2.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2792 -2.6478 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5669 -1.4246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9853 -2.2365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6181 -3.4804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9100 -3.8885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2026 -3.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4946 -3.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7872 -3.4782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0792 -3.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3718 -3.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0786 -4.7034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3777 -2.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6711 -2.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9621 -2.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9641 -3.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6712 -3.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6747 -4.7038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
1 8 1 0
8 9 1 0
5 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
7 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 22 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.43Molecular Weight (Monoisotopic): 400.1634AlogP: 2.51#Rotatable Bonds: 10Polar Surface Area: 117.12Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.18CX Basic pKa: ┄CX LogP: 2.81CX LogD: 2.74Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.21Np Likeness Score: -0.32
References 1. Sangwan R, Rajan R, Mandal PK.. (2018) HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors., 158 [PMID:30245394 ] [10.1016/j.ejmech.2018.08.073 ]