4-((1,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracen-2-yl)(hydroxy)methyl)benzonitrile

ID: ALA4543919

PubChem CID: 155552253

Max Phase: Preclinical

Molecular Formula: C22H13NO5

Molecular Weight: 371.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#Cc1ccc(C(O)c2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)cc1

Standard InChI:  InChI=1S/C22H13NO5/c23-10-11-5-7-12(8-6-11)19(25)15-9-16(24)17-18(22(15)28)21(27)14-4-2-1-3-13(14)20(17)26/h1-9,19,24-25,28H

Standard InChI Key:  CMACGNWYZVINDH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    5.8024  -23.7605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8024  -22.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0971  -23.3560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0997  -22.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3959  -22.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6892  -22.5386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6906  -23.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3949  -23.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5077  -22.5388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5061  -23.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2103  -23.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9166  -23.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9143  -22.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2095  -22.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8010  -21.3089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8036  -24.5776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2096  -24.5787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2075  -21.3152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6206  -22.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6180  -21.3080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3261  -22.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3274  -23.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0356  -23.7551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7430  -23.3441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7377  -22.5227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0290  -22.1202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4499  -23.7462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1594  -24.1516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 10  1  0
  9  2  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2 15  2  0
  1 16  2  0
 11 17  1  0
 14 18  1  0
 13 19  1  0
 19 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 19 21  1  0
 27 28  3  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4543919

    ---

Associated Targets(Human)

TOP2A Tclin DNA topoisomerase II (1334 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 371.35Molecular Weight (Monoisotopic): 371.0794AlogP: 2.83#Rotatable Bonds: 2
Polar Surface Area: 118.62Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.49CX Basic pKa: CX LogP: 4.48CX LogD: 4.45
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.47Np Likeness Score: 0.43

References

1. Liu Y, Liang Y, Jiang J, Qin Q, Wang L, Liu X..  (2019)  Design, synthesis and biological evaluation of 1,4-dihydroxyanthraquinone derivatives as anticancer agents.,  29  (9): [PMID:30846253] [10.1016/j.bmcl.2019.02.026]

Source