The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3-O,O-dibenzyl-6-deoxy-6-[4-((tert-butyl-1-carboxylate)-4-(methylthiocarbothionyl)piperazine))-1,2,3-triazol-1-yl]-L-ascorbic acid ID: ALA4544092
PubChem CID: 155552313
Max Phase: Preclinical
Molecular Formula: C33H39N5O7S2
Molecular Weight: 681.84
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)N1CCN(C(=S)SCc2cn(C[C@H](O)[C@H]3OC(=O)C(OCc4ccccc4)=C3OCc3ccccc3)nn2)CC1
Standard InChI: InChI=1S/C33H39N5O7S2/c1-33(2,3)45-31(41)36-14-16-37(17-15-36)32(46)47-22-25-18-38(35-34-25)19-26(39)27-28(42-20-23-10-6-4-7-11-23)29(30(40)44-27)43-21-24-12-8-5-9-13-24/h4-13,18,26-27,39H,14-17,19-22H2,1-3H3/t26-,27+/m0/s1
Standard InChI Key: OENQYPQRKFLLCD-RRPNLBNLSA-N
Molfile:
RDKit 2D
48 52 0 0 0 0 0 0 0 0999 V2000
11.2786 -15.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4531 -15.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5180 -14.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1931 -14.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8494 -14.0789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4997 -14.1366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2980 -14.2893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7656 -15.9939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9826 -16.0104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7899 -14.5205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8435 -12.8902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5369 -13.3236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2303 -13.7569 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.0574 -13.1133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8762 -12.0736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1068 -11.7907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6047 -12.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7852 -12.4271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1624 -16.0054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7495 -16.7106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5798 -15.9930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9892 -16.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5785 -17.4063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9872 -18.1131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8052 -18.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2129 -17.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8019 -16.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9349 -16.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5220 -17.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9264 -18.1186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7478 -18.1210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1569 -17.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3703 -13.1311 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.5532 -13.1239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1383 -13.8280 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.1508 -12.4126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5668 -11.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1679 -11.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3505 -10.9900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9335 -11.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3339 -12.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9509 -10.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3684 -9.5747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1337 -10.2669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7341 -9.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9170 -9.5437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1516 -8.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3195 -8.8405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 2 1 0
5 3 1 0
6 4 1 0
7 3 2 0
8 1 1 0
9 2 1 0
6 10 1 1
11 12 1 0
12 6 1 0
4 13 1 6
4 5 1 0
14 11 1 0
11 15 1 0
15 16 2 0
16 17 1 0
17 14 2 0
17 18 1 0
9 19 1 0
19 20 1 0
8 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
20 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 20 1 0
18 33 1 0
33 34 1 0
34 35 2 0
34 36 1 0
36 37 1 0
36 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
39 42 1 0
42 43 2 0
42 44 1 0
44 45 1 0
45 46 1 0
45 47 1 0
45 48 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 681.84Molecular Weight (Monoisotopic): 681.2291AlogP: 4.28#Rotatable Bonds: 11Polar Surface Area: 128.48Molecular Species: NEUTRALHBA: 12HBD: 1#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.57CX Basic pKa: 0.24CX LogP: 4.25CX LogD: 4.25Aromatic Rings: 3Heavy Atoms: 47QED Weighted: 0.23Np Likeness Score: -0.56
References 1. Macan AM, Harej A, Cazin I, Klobučar M, Stepanić V, Pavelić K, Pavelić SK, Schols D, Snoeck R, Andrei G, Raić-Malić S.. (2019) Antitumor and antiviral activities of 4-substituted 1,2,3-triazolyl-2,3-dibenzyl-L-ascorbic acid derivatives., 184 [PMID:31586832 ] [10.1016/j.ejmech.2019.111739 ]