The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(Acetyl-L-methionyl)-N-((S)-1-((2-amino-2-oxoethyl)-amino)-3-mercapto-1-oxopropan-2-yl)pyrrolidine-2-carboxamide ID: ALA4544128
PubChem CID: 155552601
Max Phase: Preclinical
Molecular Formula: C17H29N5O5S2
Molecular Weight: 447.58
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CSCC[C@H](NC(C)=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CS)C(=O)NCC(N)=O
Standard InChI: InChI=1S/C17H29N5O5S2/c1-10(23)20-11(5-7-29-2)17(27)22-6-3-4-13(22)16(26)21-12(9-28)15(25)19-8-14(18)24/h11-13,28H,3-9H2,1-2H3,(H2,18,24)(H,19,25)(H,20,23)(H,21,26)/t11-,12-,13-/m0/s1
Standard InChI Key: XXZGFFFWSQJJCG-AVGNSLFASA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
34.2529 -12.4628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8370 -11.8788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2157 -11.5095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6316 -12.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6222 -11.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2062 -10.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9915 -9.7012 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.1969 -9.4906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8465 -12.8882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6170 -13.1868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3083 -11.9133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3083 -12.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5731 -14.0112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3280 -13.5315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7793 -14.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0239 -13.1497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7354 -12.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4510 -13.9741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.4510 -13.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7354 -11.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4510 -11.5011 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
40.1624 -12.7376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.8781 -13.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5937 -11.9133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.5937 -12.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3051 -13.1497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.4583 -12.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8743 -12.8320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2436 -11.4534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4 9 1 0
12 16 1 0
19 22 1 0
25 26 1 0
1 2 1 0
2 4 1 0
4 3 2 0
2 5 1 1
5 6 1 0
6 7 1 0
7 8 1 0
9 10 1 0
10 12 1 6
12 11 2 0
10 13 1 0
14 15 1 0
15 13 1 0
14 9 1 0
16 17 1 0
17 19 1 0
19 18 2 0
17 20 1 1
20 21 1 0
22 23 1 0
23 25 1 0
25 24 2 0
1 27 1 0
27 28 1 0
27 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.58Molecular Weight (Monoisotopic): 447.1610AlogP: -1.75#Rotatable Bonds: 11Polar Surface Area: 150.70Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.96CX Basic pKa: ┄CX LogP: -2.77CX LogD: -2.77Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.24Np Likeness Score: -0.77
References 1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A.. (2018) Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model., 61 (24): [PMID:30507195 ] [10.1021/acs.jmedchem.8b01471 ]