1-(Acetyl-L-methionyl)-N-((S)-1-((2-amino-2-oxoethyl)-amino)-3-mercapto-1-oxopropan-2-yl)pyrrolidine-2-carboxamide

ID: ALA4544128

PubChem CID: 155552601

Max Phase: Preclinical

Molecular Formula: C17H29N5O5S2

Molecular Weight: 447.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CSCC[C@H](NC(C)=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CS)C(=O)NCC(N)=O

Standard InChI:  InChI=1S/C17H29N5O5S2/c1-10(23)20-11(5-7-29-2)17(27)22-6-3-4-13(22)16(26)21-12(9-28)15(25)19-8-14(18)24/h11-13,28H,3-9H2,1-2H3,(H2,18,24)(H,19,25)(H,20,23)(H,21,26)/t11-,12-,13-/m0/s1

Standard InChI Key:  XXZGFFFWSQJJCG-AVGNSLFASA-N

Molfile:  

 
     RDKit          2D

 29 29  0  0  0  0  0  0  0  0999 V2000
   34.2529  -12.4628    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8370  -11.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2157  -11.5095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6316  -12.0935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6222  -11.0841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2062  -10.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9915   -9.7012    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.1969   -9.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8465  -12.8882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6170  -13.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3083  -11.9133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.3083  -12.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5731  -14.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3280  -13.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7793  -14.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0239  -13.1497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.7354  -12.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4510  -13.9741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4510  -13.1497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7354  -11.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4510  -11.5011    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   40.1624  -12.7376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.8781  -13.1497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5937  -11.9133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.5937  -12.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3051  -13.1497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4583  -12.2481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8743  -12.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2436  -11.4534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  9  1  0
 12 16  1  0
 19 22  1  0
 25 26  1  0
  1  2  1  0
  2  4  1  0
  4  3  2  0
  2  5  1  1
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9 10  1  0
 10 12  1  6
 12 11  2  0
 10 13  1  0
 14 15  1  0
 15 13  1  0
 14  9  1  0
 16 17  1  0
 17 19  1  0
 19 18  2  0
 17 20  1  1
 20 21  1  0
 22 23  1  0
 23 25  1  0
 25 24  2  0
  1 27  1  0
 27 28  1  0
 27 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4544128

    ---

Associated Targets(non-human)

Tlr4 Toll-like receptor 4 (76 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.58Molecular Weight (Monoisotopic): 447.1610AlogP: -1.75#Rotatable Bonds: 11
Polar Surface Area: 150.70Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 9.96CX Basic pKa: CX LogP: -2.77CX LogD: -2.77
Aromatic Rings: Heavy Atoms: 29QED Weighted: 0.24Np Likeness Score: -0.77

References

1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A..  (2018)  Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model.,  61  (24): [PMID:30507195] [10.1021/acs.jmedchem.8b01471]

Source