The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R/S)-5-((1-(2-Hydroxy-3-(9-oxoacridin-10(9H)-yl)propyl)-1H-indol-3-yl)methylene)-1,3-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione ID: ALA4544130
PubChem CID: 155552635
Max Phase: Preclinical
Molecular Formula: C31H26N4O5
Molecular Weight: 534.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN1C(=O)C(=Cc2cn(CC(O)Cn3c4ccccc4c(=O)c4ccccc43)c3ccccc23)C(=O)N(C)C1=O
Standard InChI: InChI=1S/C31H26N4O5/c1-32-29(38)24(30(39)33(2)31(32)40)15-19-16-34(25-12-6-3-9-21(19)25)17-20(36)18-35-26-13-7-4-10-22(26)28(37)23-11-5-8-14-27(23)35/h3-16,20,36H,17-18H2,1-2H3
Standard InChI Key: GAZPMMMRETXIIJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
17.2516 -17.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2365 -16.6139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5136 -16.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5481 -17.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8247 -17.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8095 -16.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0845 -16.2388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1150 -17.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3854 -17.4992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3703 -16.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6462 -16.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9367 -16.6989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9557 -17.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6804 -17.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1312 -18.7296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0687 -15.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7752 -14.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4975 -15.3868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7595 -14.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4660 -13.7370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2241 -14.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7643 -13.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5346 -12.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3351 -12.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5752 -11.9436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0159 -11.3429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2134 -11.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9770 -12.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5865 -13.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9384 -14.2439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4667 -14.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8153 -15.6628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6375 -15.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1099 -15.0577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7601 -14.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2299 -13.6295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6448 -14.8485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3427 -16.3389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9319 -15.1288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9867 -16.4828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
8 15 2 0
7 16 1 0
16 17 1 0
17 18 1 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 24 1 0
23 20 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
22 29 1 0
29 30 2 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
31 37 2 0
32 38 1 0
34 39 1 0
33 40 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.57Molecular Weight (Monoisotopic): 534.1903AlogP: 3.60#Rotatable Bonds: 5Polar Surface Area: 104.85Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.87CX LogD: 3.87Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -0.82
References 1. Singh H, Kaur M, Kaur H, Sharma I, Bhandari A, Kaur G, Singh P.. (2019) Structural tuning of acridones for developing anticancer agents targeting dihydrofolate reductase., 29 (19): [PMID:31447082 ] [10.1016/j.bmcl.2019.126631 ]