The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,4-bis(benzyloxy)-5-(2-(4-decyl-1H-1,2,3-triazol-1-yl)ethylidene)furan-2(5H)-one ID: ALA4545133
PubChem CID: 155553030
Max Phase: Preclinical
Molecular Formula: C32H39N3O4
Molecular Weight: 529.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCc1cn(C/C=C2\OC(=O)C(OCc3ccccc3)=C2OCc2ccccc2)nn1
Standard InChI: InChI=1S/C32H39N3O4/c1-2-3-4-5-6-7-8-15-20-28-23-35(34-33-28)22-21-29-30(37-24-26-16-11-9-12-17-26)31(32(36)39-29)38-25-27-18-13-10-14-19-27/h9-14,16-19,21,23H,2-8,15,20,22,24-25H2,1H3/b29-21-
Standard InChI Key: NMIJWLWHFWIMBB-ANYBSYGZSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
9.8753 -30.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0499 -30.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1147 -29.3785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7899 -29.3950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4461 -28.8997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0965 -28.9575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8948 -29.1102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3623 -30.8148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5794 -30.8313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4403 -27.7111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1336 -28.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6541 -27.9342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4730 -26.8944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7036 -26.6116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2014 -27.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3819 -27.2480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7592 -30.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3463 -31.5315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1765 -30.8139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5859 -31.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1752 -32.2272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5839 -32.9339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4020 -32.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8096 -32.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3986 -31.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5316 -31.5239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1188 -32.2283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5231 -32.9395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3445 -32.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7537 -32.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9671 -27.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1499 -27.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7350 -28.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9179 -28.6416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5030 -29.3457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6859 -29.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2710 -30.0425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4541 -30.0352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0393 -30.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 2 1 0
5 3 1 0
6 4 2 0
7 3 2 0
8 1 1 0
9 2 1 0
10 11 1 0
11 6 1 0
4 5 1 0
12 10 1 0
10 13 1 0
13 14 2 0
14 15 1 0
15 12 2 0
15 16 1 0
9 17 1 0
17 18 1 0
8 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
18 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 18 1 0
16 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.68Molecular Weight (Monoisotopic): 529.2941AlogP: 7.05#Rotatable Bonds: 17Polar Surface Area: 75.47Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 0.56CX LogP: 7.28CX LogD: 7.28Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.14Np Likeness Score: -0.23
References 1. Macan AM, Harej A, Cazin I, Klobučar M, Stepanić V, Pavelić K, Pavelić SK, Schols D, Snoeck R, Andrei G, Raić-Malić S.. (2019) Antitumor and antiviral activities of 4-substituted 1,2,3-triazolyl-2,3-dibenzyl-L-ascorbic acid derivatives., 184 [PMID:31586832 ] [10.1016/j.ejmech.2019.111739 ]