2,4-Diamino-8-chloro-10H-(4'-bromophenyl)-pyrimido-[5,4-b]benzothiazine 5,5-dioxide

ID: ALA454561

PubChem CID: 42598502

Max Phase: Preclinical

Molecular Formula: C16H11BrClN5O2S

Molecular Weight: 452.72

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1nc(N)c2c(n1)N(c1ccc(Br)cc1)c1cc(Cl)ccc1S2(=O)=O

Standard InChI:  InChI=1S/C16H11BrClN5O2S/c17-8-1-4-10(5-2-8)23-11-7-9(18)3-6-12(11)26(24,25)13-14(19)21-16(20)22-15(13)23/h1-7H,(H4,19,20,21,22)

Standard InChI Key:  ORRPSDCKHRZPDM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    1.1181   -9.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1181  -10.6229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4036  -11.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4036   -9.3854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3108   -9.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3108  -10.6229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0253  -11.0354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0253   -9.3854    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6380   -8.6570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4126   -8.6570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0253  -11.8604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7398  -12.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7398  -13.0979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0253  -13.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3108  -13.0979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3108  -12.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7398   -9.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7398  -10.6229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4542  -11.0354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1687  -10.6229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1687   -9.7979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4542   -9.3854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4542   -8.5604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8832  -11.0354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0253  -14.3354    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    1.8326  -11.0354    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
 12 13  1  0
  3  6  2  0
 13 14  2  0
  1  2  2  0
 14 15  1  0
  5  8  1  0
 15 16  2  0
 16 11  1  0
  7 11  1  0
 17 18  2  0
  6  7  1  0
  7 18  1  0
 17  8  1  0
  5  4  2  0
  8  9  2  0
  4  1  1  0
 17 22  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
  8 10  2  0
 22 23  1  0
  5  6  1  0
 20 24  1  0
 11 12  2  0
 14 25  1  0
  2 26  1  0
M  END

Associated Targets(non-human)

Histidine-rich protein (528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium berghei (192651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.72Molecular Weight (Monoisotopic): 450.9505AlogP: 3.67#Rotatable Bonds: 1
Polar Surface Area: 115.20Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.25CX LogP: 3.94CX LogD: 3.94
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.45Np Likeness Score: -1.37

References

1. Barazarte A, Lobo G, Gamboa N, Rodrigues JR, Capparelli MV, Alvarez-Larena A, López SE, Charris JE..  (2009)  Synthesis and antimalarial activity of pyrazolo and pyrimido benzothiazine dioxide derivatives.,  44  (3): [PMID:18835067] [10.1016/j.ejmech.2008.08.005]

Source