The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-N-[2-chloro-5-(1-{1-[4-(dimethylamino)butanoyl]piperidin-4-yl}-1H-pyrazol-4-yl)phenyl]-1,3-oxazole-4-carboxamide ID: ALA4545699
PubChem CID: 135188175
Max Phase: Preclinical
Molecular Formula: C24H30ClN7O3
Molecular Weight: 500.00
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCC(=O)N1CCC(n2cc(-c3ccc(Cl)c(NC(=O)c4coc(N)n4)c3)cn2)CC1
Standard InChI: InChI=1S/C24H30ClN7O3/c1-30(2)9-3-4-22(33)31-10-7-18(8-11-31)32-14-17(13-27-32)16-5-6-19(25)20(12-16)28-23(34)21-15-35-24(26)29-21/h5-6,12-15,18H,3-4,7-11H2,1-2H3,(H2,26,29)(H,28,34)
Standard InChI Key: ULOCUQHMLPFQHT-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
7.2597 -6.9020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7163 -5.8735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5394 -5.0183 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6087 -5.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4156 -6.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6372 -4.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7059 -3.7924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6750 -5.5690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6936 -4.9428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6794 -3.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7029 -3.1822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7358 -3.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7549 -4.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7314 -5.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7878 -5.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8652 -4.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6770 -5.7964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1275 -6.8292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0052 -6.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6803 -7.9066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8759 -7.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4096 -8.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7477 -9.9871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5892 -9.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0555 -8.8842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3004 -11.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6756 -12.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2093 -13.0824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5474 -14.0791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1001 -15.1565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4753 -16.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2958 -15.2001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4961 -11.1082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6466 -3.2175 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.5207 -5.7219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
4 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
13 15 1 0
16 15 1 0
17 16 2 0
18 17 1 0
18 19 1 0
15 19 2 0
18 20 1 0
21 20 1 0
22 21 1 0
23 22 1 0
23 24 1 0
25 24 1 0
20 25 1 0
23 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 1 0
26 33 2 0
10 34 1 0
2 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.00Molecular Weight (Monoisotopic): 499.2099AlogP: 3.53#Rotatable Bonds: 8Polar Surface Area: 122.52Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.93CX Basic pKa: 9.65CX LogP: 1.60CX LogD: -0.63Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.49Np Likeness Score: -1.72
References 1. (2018) Oxazole derivatives for use in the treatment of cancer,