2-Amino-N-[2-chloro-5-(1-{1-[4-(dimethylamino)butanoyl]piperidin-4-yl}-1H-pyrazol-4-yl)phenyl]-1,3-oxazole-4-carboxamide

ID: ALA4545699

PubChem CID: 135188175

Max Phase: Preclinical

Molecular Formula: C24H30ClN7O3

Molecular Weight: 500.00

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CCCC(=O)N1CCC(n2cc(-c3ccc(Cl)c(NC(=O)c4coc(N)n4)c3)cn2)CC1

Standard InChI:  InChI=1S/C24H30ClN7O3/c1-30(2)9-3-4-22(33)31-10-7-18(8-11-31)32-14-17(13-27-32)16-5-6-19(25)20(12-16)28-23(34)21-15-35-24(26)29-21/h5-6,12-15,18H,3-4,7-11H2,1-2H3,(H2,26,29)(H,28,34)

Standard InChI Key:  ULOCUQHMLPFQHT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    7.2597   -6.9020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7163   -5.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5394   -5.0183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6087   -5.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4156   -6.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6372   -4.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7059   -3.7924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6750   -5.5690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6936   -4.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6794   -3.7670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7029   -3.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7358   -3.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7549   -4.9490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7314   -5.5338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7878   -5.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8652   -4.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6770   -5.7964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1275   -6.8292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0052   -6.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6803   -7.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8759   -7.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4096   -8.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7477   -9.9871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5892   -9.9245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0555   -8.8842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3004  -11.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6756  -12.0421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2093  -13.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5474  -14.0791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1001  -15.1565    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4753  -16.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2958  -15.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4961  -11.1082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6466   -3.2175    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.5207   -5.7219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  1  5  1  0
  4  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
 13 15  1  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 18 19  1  0
 15 19  2  0
 18 20  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 23 24  1  0
 25 24  1  0
 20 25  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  1  0
 26 33  2  0
 10 34  1  0
  2 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4545699

    ---

Associated Targets(Human)

PAICS Tchem Multifunctional protein ADE2 (310 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 500.00Molecular Weight (Monoisotopic): 499.2099AlogP: 3.53#Rotatable Bonds: 8
Polar Surface Area: 122.52Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.93CX Basic pKa: 9.65CX LogP: 1.60CX LogD: -0.63
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.49Np Likeness Score: -1.72

References

1.  (2018)  Oxazole derivatives for use in the treatment of cancer, 

Source