The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N6-cyclopropyl-N2-(quinolin-6-yl)-9H-purine-2,6-diamine dimethanesulfonate dihydrate ID: ALA4545915
PubChem CID: 135391000
Max Phase: Preclinical
Molecular Formula: C19H27N7O8S2
Molecular Weight: 317.36
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)O.CS(=O)(=O)O.O.O.c1cnc2ccc(Nc3nc(NC4CC4)c4nc[nH]c4n3)cc2c1
Standard InChI: InChI=1S/C17H15N7.2CH4O3S.2H2O/c1-2-10-8-12(5-6-13(10)18-7-1)22-17-23-15-14(19-9-20-15)16(24-17)21-11-3-4-11;2*1-5(2,3)4;;/h1-2,5-9,11H,3-4H2,(H3,19,20,21,22,23,24);2*1H3,(H,2,3,4);2*1H2
Standard InChI Key: FZCUKXDHZVKFFA-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 36 0 0 0 0 0 0 0 0999 V2000
41.4146 -5.4435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4905 -4.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4894 -4.8700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2041 -5.2846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2024 -3.6329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9137 -4.0396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9144 -4.8659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6298 -5.2786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3448 -4.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3401 -4.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6241 -3.6279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0609 -5.2736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7739 -4.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4871 -5.2725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4757 -3.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7662 -4.0383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1968 -4.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2005 -4.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9834 -5.1061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4611 -4.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9774 -3.7748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4696 -2.7994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1810 -2.3798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0041 -2.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5845 -1.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3946 -2.5726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8089 -3.2852 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.2188 -2.5701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1004 -3.6994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5211 -3.6994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2412 -4.7765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.6556 -5.4891 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.0655 -4.7740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.9471 -5.9034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3679 -5.9034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.3235 -3.0200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
9 12 1 0
12 13 1 0
13 14 2 0
14 18 1 0
17 15 1 0
15 16 2 0
16 13 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 17 1 0
15 22 1 0
22 23 1 0
24 23 1 0
25 24 1 0
23 25 1 0
27 26 2 0
28 27 2 0
29 27 1 0
27 30 1 0
32 31 2 0
33 32 2 0
34 32 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 317.36Molecular Weight (Monoisotopic): 317.1389AlogP: 3.22#Rotatable Bonds: 4Polar Surface Area: 91.41Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.71CX Basic pKa: 4.99CX LogP: 2.51CX LogD: 2.51Aromatic Rings: 4Heavy Atoms: 24QED Weighted: 0.54Np Likeness Score: -1.41
References 1. He S, Li Q, Jiang X, Lu X, Feng F, Qu W, Chen Y, Sun H.. (2018) Design of Small Molecule Autophagy Modulators: A Promising Druggable Strategy., 61 (11): [PMID:29211480 ] [10.1021/acs.jmedchem.7b01019 ]