The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,6-dimethyl-5-n-butyl-2-{[4-(o-ethoxyphenyl)-1-piperazinyl]methyl}pyrrolo[3,4-c]pyrrole-1,3(2H,5H)-dione ID: ALA4546047
PubChem CID: 155553598
Max Phase: Preclinical
Molecular Formula: C25H34N4O3
Molecular Weight: 438.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCn1c(C)c2c(c1C)C(=O)N(CN1CCN(c3ccccc3OCC)CC1)C2=O
Standard InChI: InChI=1S/C25H34N4O3/c1-5-7-12-28-18(3)22-23(19(28)4)25(31)29(24(22)30)17-26-13-15-27(16-14-26)20-10-8-9-11-21(20)32-6-2/h8-11H,5-7,12-17H2,1-4H3
Standard InChI Key: XHIGZZTXFXABLR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
13.6694 -11.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7082 -10.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2067 -10.9916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4873 -10.6168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4612 -11.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2374 -11.7212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7434 -11.0694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2797 -10.3869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5595 -9.6107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4673 -12.5136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3904 -12.4496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4752 -9.5462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5680 -11.0956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9576 -11.8228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5160 -12.5238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9023 -13.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7270 -13.2792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1641 -12.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7765 -11.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1135 -14.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6742 -14.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0605 -15.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8858 -15.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3233 -14.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9346 -14.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3704 -13.3306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1949 -13.3575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6306 -12.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3821 -10.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9904 -10.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1658 -10.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7742 -9.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 2 0
2 3 1 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
8 9 2 0
6 10 2 0
1 11 1 0
2 12 1 0
7 13 1 0
13 14 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 20 1 0
25 26 1 0
26 27 1 0
27 28 1 0
3 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.57Molecular Weight (Monoisotopic): 438.2631AlogP: 3.68#Rotatable Bonds: 8Polar Surface Area: 58.02Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.29CX LogP: 4.01CX LogD: 4.01Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.59Np Likeness Score: -1.30
References 1. Redzicka A, Szczukowski Ł, Kochel A, Wiatrak B, Gębczak K, Czyżnikowska Ż.. (2019) COX-1/COX-2 inhibition activities and molecular docking study of newly designed and synthesized pyrrolo[3,4-c]pyrrole Mannich bases., 27 (17): [PMID:31345747 ] [10.1016/j.bmc.2019.07.033 ]