5,5'-(8-(4-methyl-2-oxo-2H-chromen-7-yloxy)imidazo[1,2-a]pyrazine-3,6-diyl)bis(thiophene-5,2-diyl)diboronic acid

ID: ALA4546072

PubChem CID: 155553309

Max Phase: Preclinical

Molecular Formula: C24H17B2N3O7S2

Molecular Weight: 545.17

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(=O)oc2cc(Oc3nc(-c4ccc(B(O)O)s4)cn4c(-c5ccc(B(O)O)s5)cnc34)ccc12

Standard InChI:  InChI=1S/C24H17B2N3O7S2/c1-12-8-22(30)36-17-9-13(2-3-14(12)17)35-24-23-27-10-16(19-5-7-21(38-19)26(33)34)29(23)11-15(28-24)18-4-6-20(37-18)25(31)32/h2-11,31-34H,1H3

Standard InChI Key:  HDICZOLKKPMHGJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   25.4730  -15.3601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1826  -14.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1798  -14.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4712  -13.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7649  -14.9511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7672  -14.1334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0613  -13.7243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3526  -14.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3543  -14.9528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0608  -15.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8910  -15.3581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4677  -12.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6475  -15.3630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9389  -14.9561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5267  -14.1445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5313  -14.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2397  -15.3690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2345  -13.7342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9410  -14.1389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5443  -13.5920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2106  -12.8492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4011  -12.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8288  -15.3806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0803  -15.0526    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.5371  -15.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9499  -16.3685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7481  -16.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8479  -12.3325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0151  -11.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3060  -11.1264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7005  -11.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0356  -12.4207    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.8821  -11.6718    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   18.4766  -10.9623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4704  -12.3777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7182  -15.6587    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   17.3134  -14.9488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3058  -16.3642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  2 11  2  0
  4 12  1  0
  9 13  1  0
 13 14  1  0
 14 19  1  0
 18 15  1  0
 15 16  2  0
 16 17  1  0
 17 14  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 18  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  2  0
 16 23  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 28  1  0
 22 28  1  0
 31 33  1  0
 33 34  1  0
 33 35  1  0
 25 36  1  0
 36 37  1  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4546072

    ---

Associated Targets(Human)

HOP-92 (41141 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 545.17Molecular Weight (Monoisotopic): 545.0694AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Singh H, Singh JV, Bhagat K, Gulati HK, Sanduja M, Kumar N, Kinarivala N, Sharma S..  (2019)  Rational approaches, design strategies, structure activity relationship and mechanistic insights for therapeutic coumarin hybrids.,  27  (16): [PMID:31255497] [10.1016/j.bmc.2019.06.033]

Source