The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Chloro-N-{3-[5-(2,4,5-trifluoro-3-hydroxy-benzoyl)-thiophen-2-yl]-phenyl}-benzenesulfonamide ID: ALA4546082
PubChem CID: 155553373
Max Phase: Preclinical
Molecular Formula: C23H13ClF3NO4S2
Molecular Weight: 523.94
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(-c2cccc(NS(=O)(=O)c3ccc(Cl)cc3)c2)s1)c1cc(F)c(F)c(O)c1F
Standard InChI: InChI=1S/C23H13ClF3NO4S2/c24-13-4-6-15(7-5-13)34(31,32)28-14-3-1-2-12(10-14)18-8-9-19(33-18)22(29)16-11-17(25)21(27)23(30)20(16)26/h1-11,28,30H
Standard InChI Key: CSGXUMJCTCEVTD-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
36.2371 -12.1671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9470 -11.7626 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.2417 -11.3501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4345 -11.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4333 -12.1776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1414 -12.5866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8510 -12.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8482 -11.3545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1396 -10.9492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1371 -10.1320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8436 -9.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4282 -9.7256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5897 -10.0537 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.1347 -9.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7239 -8.7383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9252 -8.9107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7253 -12.5857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.9459 -9.5262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2798 -10.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0919 -10.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5712 -9.6935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2324 -8.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4212 -8.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4262 -11.1022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2818 -12.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8002 -13.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1338 -13.9162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9476 -14.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4266 -13.3328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0903 -12.5903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7267 -10.9497 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.1412 -13.4038 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.5594 -12.5846 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.2828 -14.7454 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 11 2 0
5 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
14 18 1 0
20 24 1 0
24 2 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
4 31 1 0
6 32 1 0
7 33 1 0
28 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.94Molecular Weight (Monoisotopic): 522.9927AlogP: 6.22#Rotatable Bonds: 6Polar Surface Area: 83.47Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.17CX Basic pKa: ┄CX LogP: 6.21CX LogD: 4.91Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.23Np Likeness Score: -1.43
References 1. Abdelsamie AS, Herath S, Biskupek Y, Börger C, Siebenbürger L, Salah M, Scheuer C, Marchais-Oberwinkler S, Frotscher M, Pohlemann T, Menger MD, Hartmann RW, Laschke MW, van Koppen CJ.. (2019) Targeted Endocrine Therapy: Design, Synthesis, and Proof-of-Principle of 17β-Hydroxysteroid Dehydrogenase Type 2 Inhibitors in Bone Fracture Healing., 62 (3): [PMID:30645111 ] [10.1021/acs.jmedchem.8b01493 ]