5-methyl-N-((S)-1-(((S)-4-methyl-1-(((S)-1-(((S)-4-methyl-1-((R)-2-methyloxiran-2-yl)-1-oxopentan-2-yl)amino)-1-oxo-3-phenylpropan-2-yl)amino)-1-oxopentan-2-yl)amino)-1-oxo-3-(pyridin-2-yl)propan-2-yl)isoxazole-3-carboxamide

ID: ALA4546157

PubChem CID: 155553273

Max Phase: Preclinical

Molecular Formula: C37H48N6O7

Molecular Weight: 688.83

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C(=O)N[C@@H](Cc2ccccn2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]2(C)CO2)no1

Standard InChI:  InChI=1S/C37H48N6O7/c1-22(2)16-27(32(44)37(6)21-49-37)39-34(46)29(19-25-12-8-7-9-13-25)41-33(45)28(17-23(3)4)40-35(47)30(20-26-14-10-11-15-38-26)42-36(48)31-18-24(5)50-43-31/h7-15,18,22-23,27-30H,16-17,19-21H2,1-6H3,(H,39,46)(H,40,47)(H,41,45)(H,42,48)/t27-,28-,29-,30-,37+/m0/s1

Standard InChI Key:  ZMGVDIPFQKCTCC-UEYMUWAXSA-N

Molfile:  

 
     RDKit          2D

 50 53  0  0  0  0  0  0  0  0999 V2000
    3.3582  -15.4009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0717  -14.9889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7894  -15.4009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3582  -16.2289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6404  -14.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5071  -14.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2248  -15.4009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9425  -14.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6603  -15.4009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3779  -14.9889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0915  -15.4009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8091  -14.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5269  -15.4009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2446  -14.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9622  -15.4009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6800  -14.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5074  -14.9889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0913  -14.2711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0871  -15.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5071  -14.1608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7894  -16.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0915  -16.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9425  -14.1608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2446  -14.1608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8091  -14.1608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9622  -16.2289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6603  -16.2289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8050  -16.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8012  -17.4659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5139  -17.8778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2284  -17.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2257  -16.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5125  -16.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9581  -13.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5522  -14.1686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7423  -13.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3303  -14.7163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8856  -15.3298    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4052  -13.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7299  -13.9277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9581  -12.9249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6560  -13.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6560  -12.9249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3696  -14.1608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5029  -16.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4984  -17.4659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2111  -17.8778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9256  -17.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9230  -16.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2097  -16.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  2  0
  1  5  1  0
  3  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 18 17  1  0
 16 18  1  0
 16 19  1  6
  6 20  2  0
  3 21  1  6
 11 22  1  6
  8 23  1  1
 14 24  1  1
 12 25  2  0
 15 26  2  0
  9 27  2  0
 22 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 24 34  1  0
  5 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  1  0
 38  5  2  0
 36 39  1  0
 34 40  1  0
 34 41  1  0
 23 42  1  0
 42 43  1  0
 42 44  1  0
 21 45  1  0
 45 46  2  0
 46 47  1  0
 47 48  2  0
 48 49  1  0
 49 50  2  0
 50 45  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4546157

    ---

Associated Targets(Human)

PSMB5 Tclin Proteasome Macropain subunit MB1 (2451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 688.83Molecular Weight (Monoisotopic): 688.3584AlogP: 2.87#Rotatable Bonds: 18
Polar Surface Area: 184.92Molecular Species: NEUTRALHBA: 9HBD: 4
#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.57CX Basic pKa: 4.52CX LogP: 3.70CX LogD: 3.70
Aromatic Rings: 3Heavy Atoms: 50QED Weighted: 0.15Np Likeness Score: -0.44

References

1. Lei M, Zhang H, Miao H, Du X, Zhou H, Wang J, Wang X, Feng H, Shi J, Liu Z, Shen J, Zhu Y..  (2019)  Preparation and biological evaluation of soluble tetrapeptide epoxyketone proteasome inhibitors.,  27  (18): [PMID:31383629] [10.1016/j.bmc.2019.07.044]

Source