4,4'-(1,1'-binaphthyl-4,4'-diylbis(azanediyl))dibenzoic acid

ID: ALA4546170

PubChem CID: 155553340

Max Phase: Preclinical

Molecular Formula: C34H24N2O4

Molecular Weight: 524.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc(Nc2ccc(-c3ccc(Nc4ccc(C(=O)O)cc4)c4ccccc34)c3ccccc23)cc1

Standard InChI:  InChI=1S/C34H24N2O4/c37-33(38)21-9-13-23(14-10-21)35-31-19-17-27(25-5-1-3-7-29(25)31)28-18-20-32(30-8-4-2-6-26(28)30)36-24-15-11-22(12-16-24)34(39)40/h1-20,35-36H,(H,37,38)(H,39,40)

Standard InChI Key:  XJKTVPCHTCNERE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
    1.0840   -4.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0829   -5.7103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7909   -6.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7892   -4.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4978   -4.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4985   -5.7061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2071   -6.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9153   -5.7024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9106   -4.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2015   -4.4769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2078   -6.9271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2098   -8.5609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9190   -8.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9141   -7.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5007   -8.1530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5001   -7.3368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7940   -6.9309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0881   -7.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0926   -8.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7992   -8.5617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1972   -3.6597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9027   -3.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6080   -3.6556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3130   -3.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3091   -2.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5943   -2.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8922   -2.4352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0162   -2.0095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7266   -2.4134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0107   -1.1923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2125   -9.3781    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9216   -9.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9209  -10.5998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6292  -11.0059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3364  -10.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3310   -9.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6222   -9.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0485  -10.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0523  -11.8168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7542  -10.5877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 16  2  0
 15 12  2  0
 12 13  1  0
 13 14  2  0
 14 11  1  0
  7 11  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 10 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 28 29  1  0
 28 30  2  0
 25 28  1  0
 12 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 38 39  1  0
 38 40  2  0
 35 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4546170

    ---

Associated Targets(Human)

dsDNA (365 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
quadruplex DNA (2700 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.58Molecular Weight (Monoisotopic): 524.1736AlogP: 8.54#Rotatable Bonds: 7
Polar Surface Area: 98.66Molecular Species: ACIDHBA: 4HBD: 4
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.35CX Basic pKa: CX LogP: 7.79CX LogD: 2.42
Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.17Np Likeness Score: -0.30

References

1. Chauhan A, Paul R, Debnath M, Bessi I, Mandal S, Schwalbe H, Dash J..  (2016)  Synthesis of Fluorescent Binaphthyl Amines That Bind c-MYC G-Quadruplex DNA and Repress c-MYC Expression.,  59  (15): [PMID:27442915] [10.1021/acs.jmedchem.6b00328]

Source