3-((6-(Aminomethyl)pyrimidin-4-yl)oxy)-N-(quinolin-2-ylmethyl)benzamide hydrochloride

ID: ALA4546171

PubChem CID: 135186016

Max Phase: Preclinical

Molecular Formula: C22H20ClN5O2

Molecular Weight: 385.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.NCc1cc(Oc2cccc(C(=O)NCc3ccc4ccccc4n3)c2)ncn1

Standard InChI:  InChI=1S/C22H19N5O2.ClH/c23-12-18-11-21(26-14-25-18)29-19-6-3-5-16(10-19)22(28)24-13-17-9-8-15-4-1-2-7-20(15)27-17;/h1-11,14H,12-13,23H2,(H,24,28);1H

Standard InChI Key:  LSZLQDAUPLWUHJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   27.3134   -6.8357    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   21.0162   -9.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0162   -8.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7072   -8.0087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7072   -7.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0162   -6.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2964   -7.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2964   -8.0087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4271   -6.7706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4271   -5.9644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7072   -5.5614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7072   -4.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4271   -4.3232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1180   -4.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1180   -5.5614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8379   -4.3232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8379   -3.5171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2964   -9.6211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7072   -9.6211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4271   -9.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1180   -9.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8379   -9.2180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5289   -9.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2487   -9.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9397   -9.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9397  -10.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2487  -10.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5289  -10.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8379  -10.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1180  -10.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  3  8  2  0
  5  9  1  0
  9 10  1  0
 11 10  2  0
 12 11  1  0
 12 13  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
 14 16  1  0
 16 17  1  0
  2 18  2  0
  2 19  1  0
 19 20  1  0
 20 21  1  0
 22 21  2  0
 22 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 28 23  1  0
 29 28  1  0
 30 29  2  0
 21 30  1  0
M  END

Associated Targets(Human)

LOXL2 Tchem Lysyl oxidase homolog 2 (834 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.43Molecular Weight (Monoisotopic): 385.1539AlogP: 3.21#Rotatable Bonds: 6
Polar Surface Area: 103.02Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.07CX LogP: 2.39CX LogD: 1.64
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: -1.35

References

1.  (2018)  Lysyl oxidase-like 2 inhibitors and uses thereof, 

Source