The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-methyl-3-(((5-(1-methyl-1H-pyrazol-3-yl)pyridin-3-yl)methyl)amino)-N-(3-(trifluoromethyl)phenyl)benzamide ID: ALA4546339
PubChem CID: 155552522
Max Phase: Preclinical
Molecular Formula: C25H22F3N5O
Molecular Weight: 465.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1NCc1cncc(-c2ccn(C)n2)c1
Standard InChI: InChI=1S/C25H22F3N5O/c1-16-6-7-18(24(34)31-21-5-3-4-20(12-21)25(26,27)28)11-23(16)30-14-17-10-19(15-29-13-17)22-8-9-33(2)32-22/h3-13,15,30H,14H2,1-2H3,(H,31,34)
Standard InChI Key: ISFMOWLMGGXLTK-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
2.9496 -10.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9484 -10.8776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6565 -11.2865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3661 -10.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3633 -10.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6547 -9.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0694 -9.6432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7787 -10.0491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4849 -9.6378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1925 -10.0471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8982 -9.6366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8956 -8.8185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1813 -8.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4786 -8.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6072 -10.0428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6099 -10.8600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3136 -9.6319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0227 -10.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0208 -10.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7291 -11.2619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4364 -10.8509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4311 -10.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7223 -9.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7678 -8.4225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1360 -9.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8465 -10.0199 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.1304 -8.7989 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.8398 -9.1996 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.2412 -9.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1556 -8.8332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3562 -8.6635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9478 -9.3713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4948 -9.9784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0237 -7.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
11 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
14 24 1 0
22 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 2 0
33 29 1 0
1 29 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.48Molecular Weight (Monoisotopic): 465.1776AlogP: 5.67#Rotatable Bonds: 6Polar Surface Area: 71.84Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.95CX LogP: 4.90CX LogD: 4.90Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -2.15
References 1. Jeffries DE, Borza CM, Blobaum AL, Pozzi A, Lindsley CW.. (2020) Discovery of VU6015929: A Selective Discoidin Domain Receptor 1/2 (DDR1/2) Inhibitor to Explore the Role of DDR1 in Antifibrotic Therapy., 11 (1): [PMID:31938459 ] [10.1021/acsmedchemlett.9b00382 ]