The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-Cinnamoylphenyl)thieno[2,3-b]quinoline-2-carboxamide ID: ALA4546479
PubChem CID: 155552324
Max Phase: Preclinical
Molecular Formula: C27H18N2O2S
Molecular Weight: 434.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccccc1)c1ccc(NC(=O)c2cc3cc4ccccc4nc3s2)cc1
Standard InChI: InChI=1S/C27H18N2O2S/c30-24(15-10-18-6-2-1-3-7-18)19-11-13-22(14-12-19)28-26(31)25-17-21-16-20-8-4-5-9-23(20)29-27(21)32-25/h1-17H,(H,28,31)/b15-10+
Standard InChI Key: IGQGYVKRVJTVBZ-XNTDXEJSSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
2.8175 -27.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8163 -28.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5244 -29.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5226 -27.4334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2312 -27.8386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2320 -28.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9405 -29.0647 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9349 -27.4284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6440 -27.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6517 -28.6508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4330 -28.8967 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.9083 -28.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4207 -27.5715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7255 -28.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1407 -28.9258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1275 -27.5104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9578 -28.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3683 -29.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1847 -29.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5875 -28.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1679 -28.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3528 -28.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4046 -28.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8207 -29.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8056 -28.1827 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6379 -29.5893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0540 -30.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6519 -31.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0673 -31.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8853 -31.6964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2861 -30.9794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8684 -30.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 9 1 0
12 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 1 0
23 25 2 0
24 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.52Molecular Weight (Monoisotopic): 434.1089AlogP: 6.60#Rotatable Bonds: 5Polar Surface Area: 59.06Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.63CX Basic pKa: 3.79CX LogP: 6.52CX LogD: 6.52Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.25Np Likeness Score: -1.18
References 1. Abdelbaset MS, Abdel-Aziz M, Ramadan M, Abdelrahman MH, Abbas Bukhari SN, Ali TFS, Abuo-Rahma GEA.. (2019) Discovery of novel thienoquinoline-2-carboxamide chalcone derivatives as antiproliferative EGFR tyrosine kinase inhibitors., 27 (6): [PMID:30744932 ] [10.1016/j.bmc.2019.02.012 ]