5-(4-(Pyrazin-2-yl)-1H-1,2,3-triazol-1-yl)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic Acid

ID: ALA4546548

PubChem CID: 135356723

Max Phase: Preclinical

Molecular Formula: C24H22N6O2

Molecular Weight: 426.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc(-c2ccc(C3CCNCC3)cc2)cc(-n2cc(-c3cnccn3)nn2)c1

Standard InChI:  InChI=1S/C24H22N6O2/c31-24(32)20-11-19(17-3-1-16(2-4-17)18-5-7-25-8-6-18)12-21(13-20)30-15-23(28-29-30)22-14-26-9-10-27-22/h1-4,9-15,18,25H,5-8H2,(H,31,32)

Standard InChI Key:  IFTJITSFPMCWIG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   15.3821  -11.9209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1975  -11.9220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6044  -11.2175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1971  -10.5114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3785  -10.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9753  -11.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4179  -11.2152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8257  -11.9246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6421  -11.9252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0517  -11.2170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6389  -10.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8238  -10.5098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8671  -11.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2753  -11.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0889  -11.9242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5006  -11.2178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0924  -10.5088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2726  -10.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9673   -9.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3732   -9.0988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1501   -9.8112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9743  -12.6324    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1616  -12.7181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9919  -13.5175    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6997  -13.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3068  -13.3789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7838  -14.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1212  -15.2160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2064  -16.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9537  -16.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6165  -15.8758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5280  -15.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
  5 19  1  0
 19 20  1  0
 19 21  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 22  1  0
  1 22  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 25 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4546548

    ---

Associated Targets(Human)

P2RY14 Tchem Purinergic receptor P2Y14 (692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.48Molecular Weight (Monoisotopic): 426.1804AlogP: 3.56#Rotatable Bonds: 5
Polar Surface Area: 105.82Molecular Species: ZWITTERIONHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.85CX Basic pKa: 10.07CX LogP: 0.60CX LogD: 0.60
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -1.06

References

1. Junker A, Balasubramanian R, Ciancetta A, Uliassi E, Kiselev E, Martiriggiano C, Trujillo K, Mtchedlidze G, Birdwell L, Brown KA, Harden TK, Jacobson KA..  (2016)  Structure-Based Design of 3-(4-Aryl-1H-1,2,3-triazol-1-yl)-Biphenyl Derivatives as P2Y14 Receptor Antagonists.,  59  (13): [PMID:27331270] [10.1021/acs.jmedchem.6b00044]

Source