The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Eudesmanomolide ID: ALA4546560
PubChem CID: 155552675
Max Phase: Preclinical
Molecular Formula: C19H24O7
Molecular Weight: 364.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)OCC1=C2CC[C@@]3(C)[C@H](O)CC(OC(C)=O)=C(C)[C@@H]3[C@H]2OC1=O
Standard InChI: InChI=1S/C19H24O7/c1-9-14(25-11(3)21)7-15(22)19(4)6-5-12-13(8-24-10(2)20)18(23)26-17(12)16(9)19/h15-17,22H,5-8H2,1-4H3/t15-,16-,17+,19+/m1/s1
Standard InChI Key: GSPSVKCNUJVZQR-VXNCWWDNSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
7.1442 -5.8153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1442 -6.6325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8495 -7.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8495 -5.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5548 -5.8153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5513 -6.6324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9669 -5.8213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2603 -5.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9634 -6.6384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2539 -7.0423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4187 -7.8419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2302 -7.9323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5667 -7.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2491 -6.2239 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.6345 -8.6424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3829 -7.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7889 -6.4763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6061 -6.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0173 -7.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0122 -5.7642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5475 -4.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8495 -4.5854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8504 -7.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4371 -7.0421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7288 -6.6345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0217 -7.0441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7276 -5.8173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5434 -7.4455 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
5 8 1 0
6 10 1 0
9 7 1 0
7 8 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 2 0
10 14 1 1
12 15 2 0
13 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
5 21 1 1
4 22 1 1
3 23 1 0
2 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
6 28 1 6
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 364.39Molecular Weight (Monoisotopic): 364.1522AlogP: 1.79#Rotatable Bonds: 3Polar Surface Area: 99.13Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.03CX Basic pKa: ┄CX LogP: 0.30CX LogD: 0.30Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.60Np Likeness Score: 2.50