Eudesmanomolide

ID: ALA4546560

PubChem CID: 155552675

Max Phase: Preclinical

Molecular Formula: C19H24O7

Molecular Weight: 364.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)OCC1=C2CC[C@@]3(C)[C@H](O)CC(OC(C)=O)=C(C)[C@@H]3[C@H]2OC1=O

Standard InChI:  InChI=1S/C19H24O7/c1-9-14(25-11(3)21)7-15(22)19(4)6-5-12-13(8-24-10(2)20)18(23)26-17(12)16(9)19/h15-17,22H,5-8H2,1-4H3/t15-,16-,17+,19+/m1/s1

Standard InChI Key:  GSPSVKCNUJVZQR-VXNCWWDNSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    7.1442   -5.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1442   -6.6325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8495   -7.0369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8495   -5.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5548   -5.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5513   -6.6324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9669   -5.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2603   -5.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9634   -6.6384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2539   -7.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4187   -7.8419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2302   -7.9323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5667   -7.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2491   -6.2239    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.6345   -8.6424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3829   -7.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7889   -6.4763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6061   -6.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0173   -7.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0122   -5.7642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5475   -4.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8495   -4.5854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8504   -7.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4371   -7.0421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7288   -6.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0217   -7.0441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7276   -5.8173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5434   -7.4455    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  8  1  0
  6 10  1  0
  9  7  1  0
  7  8  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  2  0
 10 14  1  1
 12 15  2  0
 13 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
  5 21  1  1
  4 22  1  1
  3 23  1  0
  2 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
  6 28  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4546560

    ---

Associated Targets(Human)

BGC-823 (3035 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-8 (3484 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.39Molecular Weight (Monoisotopic): 364.1522AlogP: 1.79#Rotatable Bonds: 3
Polar Surface Area: 99.13Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.03CX Basic pKa: CX LogP: 0.30CX LogD: 0.30
Aromatic Rings: Heavy Atoms: 26QED Weighted: 0.60Np Likeness Score: 2.50

References

1. Taleghani A, Emami SA, Tayarani-Najaran Z..  (2020)  Artemisia: a promising plant for the treatment of cancer.,  28  (1): [PMID:31784199] [10.1016/j.bmc.2019.115180]

Source