1-((5-Bromo-4-((4-bromonaphth-1-yl)methyl)-4H-1,2,4-triazol-3-yl)thio)-N-(pyridin-3-yl)methanesulfonamide

ID: ALA4546569

PubChem CID: 138454759

Max Phase: Preclinical

Molecular Formula: C19H15Br2N5O2S2

Molecular Weight: 569.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(CSc1nnc(Br)n1Cc1ccc(Br)c2ccccc12)Nc1cccnc1

Standard InChI:  InChI=1S/C19H15Br2N5O2S2/c20-17-8-7-13(15-5-1-2-6-16(15)17)11-26-18(21)23-24-19(26)29-12-30(27,28)25-14-4-3-9-22-10-14/h1-10,25H,11-12H2

Standard InChI Key:  KPBJDNPRRPXSOG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   12.7408  -10.0539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1535  -10.7638    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.5619  -10.0514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8279  -13.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1145  -13.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1141  -14.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8265  -14.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5375  -13.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5401  -14.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2428  -14.8617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9476  -14.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9411  -13.6348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2337  -13.2326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8279  -12.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1161  -12.0048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0277  -11.1900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2243  -11.0201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8115  -11.7320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3625  -12.3392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7337  -10.7721    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.4492  -11.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1930  -13.1427    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   11.8294  -15.6982    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   13.8646  -11.1681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5696  -10.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2764  -11.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9809  -10.7477    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9759   -9.9297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2605   -9.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5589   -9.9410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  4  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  8  2  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 16 20  1  0
 20 21  1  0
 19 22  1  0
  7 23  1  0
 21  2  1  0
  2 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4546569

    ---

Associated Targets(Human)

SLC22A12 Tclin Solute carrier family 22 member 12 (799 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 569.30Molecular Weight (Monoisotopic): 566.9034AlogP: 4.89#Rotatable Bonds: 7
Polar Surface Area: 89.77Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.47CX Basic pKa: 3.30CX LogP: 3.73CX LogD: 3.70
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.32Np Likeness Score: -1.76

References

1. Wu JW, Yin L, Liu YQ, Zhang H, Xie YF, Wang RL, Zhao GL..  (2019)  Synthesis, biological evaluation and 3D-QSAR studies of 1,2,4-triazole-5-substituted carboxylic acid bioisosteres as uric acid transporter 1 (URAT1) inhibitors for the treatment of hyperuricemia associated with gout.,  29  (3): [PMID:30579795] [10.1016/j.bmcl.2018.12.036]

Source