N-(naphthalen-2-yl)-2-[4-(4-oxo-3,4-dihydroquinazolin-2-yl)phenoxy]acetamide

ID: ALA4546596

PubChem CID: 155552391

Max Phase: Preclinical

Molecular Formula: C26H19N3O3

Molecular Weight: 421.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(COc1ccc(-c2nc3ccccc3c(=O)[nH]2)cc1)Nc1ccc2ccccc2c1

Standard InChI:  InChI=1S/C26H19N3O3/c30-24(27-20-12-9-17-5-1-2-6-19(17)15-20)16-32-21-13-10-18(11-14-21)25-28-23-8-4-3-7-22(23)26(31)29-25/h1-15H,16H2,(H,27,30)(H,28,29,31)

Standard InChI Key:  JMSPGAINXGWMRS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   15.4385   -1.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4374   -2.3837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1454   -2.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1437   -1.1553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8523   -1.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8511   -2.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5612   -2.7971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2770   -2.3878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2782   -1.5626    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5636   -1.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9797   -2.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9761   -3.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6818   -4.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3916   -3.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3913   -2.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6850   -2.3921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5636   -0.3295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0987   -4.0300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8070   -3.6225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5141   -4.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2225   -3.6246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5129   -4.8493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9296   -4.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9257   -4.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6320   -5.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6330   -3.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3399   -4.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3386   -4.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0476   -5.2614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7583   -4.8515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7556   -4.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0460   -3.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 11  1  0
 10 17  2  0
 14 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 28  2  0
 27 26  2  0
 26 23  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4546596

    ---

Associated Targets(Human)

CDK4 Tclin Cyclin-dependent kinase 4/cyclin D1 (2340 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 421.46Molecular Weight (Monoisotopic): 421.1426AlogP: 4.76#Rotatable Bonds: 5
Polar Surface Area: 84.08Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.98CX Basic pKa: 4.65CX LogP: 4.37CX LogD: 4.29
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -1.30

References

1. Sonawane V, Mohd Siddique MU, Jadav SS, Sinha BN, Jayaprakash V, Chaudhuri B..  (2019)  Cink4T, a quinazolinone-based dual inhibitor of Cdk4 and tubulin polymerization, identified via ligand-based virtual screening, for efficient anticancer therapy.,  165  [PMID:30665142] [10.1016/j.ejmech.2019.01.011]

Source