The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(cyclohexylamino)-2-oxo-1-phenylethyl)-2,4-dimethyl-N-(p-tolyl)thiazole-5-carboxamide ID: ALA4546605
PubChem CID: 155552425
Max Phase: Preclinical
Molecular Formula: C27H31N3O2S
Molecular Weight: 461.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(N(C(=O)c2sc(C)nc2C)C(C(=O)NC2CCCCC2)c2ccccc2)cc1
Standard InChI: InChI=1S/C27H31N3O2S/c1-18-14-16-23(17-15-18)30(27(32)25-19(2)28-20(3)33-25)24(21-10-6-4-7-11-21)26(31)29-22-12-8-5-9-13-22/h4,6-7,10-11,14-17,22,24H,5,8-9,12-13H2,1-3H3,(H,29,31)
Standard InChI Key: ZPFYVENXHKJLQZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
20.7863 -12.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5653 -11.9801 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.5558 -11.1587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7740 -10.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2983 -11.5784 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4002 -11.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1120 -10.7473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6883 -10.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9765 -11.1600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2647 -10.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2647 -9.9260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9765 -11.9813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4002 -11.9813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8238 -11.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6883 -9.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4036 -9.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4039 -8.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6915 -8.2870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9774 -8.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9805 -9.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2623 -12.3879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2619 -13.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9743 -13.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6885 -13.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6853 -12.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5093 -10.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5356 -13.0229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8176 -11.9778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5254 -12.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2355 -11.9812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2375 -11.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5293 -10.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9754 -14.4433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 1 0
6 8 1 0
8 9 1 0
9 10 1 0
10 3 1 0
10 11 2 0
9 12 1 0
6 13 2 0
7 14 1 0
8 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
12 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 12 1 0
4 26 1 0
1 27 1 0
14 28 1 0
14 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
23 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.63Molecular Weight (Monoisotopic): 461.2137AlogP: 5.91#Rotatable Bonds: 6Polar Surface Area: 62.30Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.55CX LogP: 5.12CX LogD: 5.12Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -1.74
References 1. Makane VB, Krishna VS, Krishna EV, Shukla M, Mahizhaveni B, Misra S, Chopra S, Sriram D, Dusthackeer VNA, Rode HB.. (2019) Synthesis and evaluation of α-aminoacyl amides as antitubercular agents effective on drug resistant tuberculosis., 164 [PMID:30654238 ] [10.1016/j.ejmech.2019.01.002 ]