The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(((6-(Aminomethyl)pyrimidin-4-yl)amino)methyl)-N-(3-(trifluoromethyl)phenyl)benzamide hydrochloride ID: ALA4546635
PubChem CID: 135186051
Max Phase: Preclinical
Molecular Formula: C20H19ClF3N5O
Molecular Weight: 401.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.NCc1cc(NCc2cccc(C(=O)Nc3cccc(C(F)(F)F)c3)c2)ncn1
Standard InChI: InChI=1S/C20H18F3N5O.ClH/c21-20(22,23)15-5-2-6-16(8-15)28-19(29)14-4-1-3-13(7-14)11-25-18-9-17(10-24)26-12-27-18;/h1-9,12H,10-11,24H2,(H,28,29)(H,25,26,27);1H
Standard InChI Key: QGZCBDAAIARLEV-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
27.7554 -4.9205 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.5728 -9.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8773 -9.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9060 -8.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2106 -7.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4747 -8.2619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4595 -9.0868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1414 -9.5053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2393 -7.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5439 -6.6238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5726 -5.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8772 -5.3803 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9058 -4.5808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6164 -4.1998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2982 -4.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2831 -5.4433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0342 -4.2238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0629 -3.4242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5441 -10.3542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2833 -9.1736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2984 -8.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0344 -7.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0631 -7.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3676 -6.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6317 -7.1053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6166 -7.9302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7736 -6.7736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7988 -5.9740 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.4665 -7.1736 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.4665 -6.3736 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
3 8 2 0
5 9 1 0
9 10 1 0
10 11 1 0
12 11 2 0
13 12 1 0
13 14 2 0
15 14 1 0
16 15 2 0
11 16 1 0
15 17 1 0
17 18 1 0
2 19 2 0
2 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
21 26 2 0
23 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 401.39Molecular Weight (Monoisotopic): 401.1463AlogP: 3.82#Rotatable Bonds: 6Polar Surface Area: 92.93Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.21CX LogP: 3.02CX LogD: 2.15Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.58Np Likeness Score: -1.73
References 1. (2018) Lysyl oxidase-like 2 inhibitors and uses thereof,