The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,5-bis(4-fluorophenyl)-2-(((4-(4-(4-fluorophenyl)-1H-1,2,3-triazol-1-yl)phenyl)sulfonyl)methyl)oxazole ID: ALA4546645
PubChem CID: 155552569
Max Phase: Preclinical
Molecular Formula: C30H19F3N4O3S
Molecular Weight: 572.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(Cc1nc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)o1)c1ccc(-n2cc(-c3ccc(F)cc3)nn2)cc1
Standard InChI: InChI=1S/C30H19F3N4O3S/c31-22-7-1-19(2-8-22)27-17-37(36-35-27)25-13-15-26(16-14-25)41(38,39)18-28-34-29(20-3-9-23(32)10-4-20)30(40-28)21-5-11-24(33)12-6-21/h1-17H,18H2
Standard InChI Key: OSGSWGCRUKDVBP-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
22.5058 -25.6095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5099 -24.7923 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.8001 -25.1973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2841 -24.0865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1013 -24.0865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8001 -23.4281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0229 -23.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0229 -24.4979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8002 -24.7503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3271 -24.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7329 -25.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5493 -25.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9587 -24.7946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5457 -24.0846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7306 -24.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7761 -24.7915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.2573 -25.4520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0342 -25.1984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0331 -24.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2556 -24.1298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7350 -23.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4443 -24.3704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1457 -23.9567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1382 -23.1409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4235 -22.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7251 -23.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3113 -23.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3145 -22.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6037 -22.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8907 -22.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8929 -23.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6043 -23.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3113 -24.8996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6081 -24.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8969 -24.8822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8885 -25.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5972 -26.1156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3055 -25.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1826 -22.0378 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.1774 -26.1029 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.8414 -22.7245 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 4 1 0
5 2 1 0
2 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 16 1 0
13 16 1 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
7 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
8 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
30 39 1 0
36 40 1 0
24 41 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 572.57Molecular Weight (Monoisotopic): 572.1130AlogP: 6.65#Rotatable Bonds: 7Polar Surface Area: 90.88Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.18CX Basic pKa: ┄CX LogP: 6.78CX LogD: 6.78Aromatic Rings: 6Heavy Atoms: 41QED Weighted: 0.21Np Likeness Score: -1.46
References 1. Patil PC, Tan J, Demuth DR, Luzzio FA.. (2019) 'Second-generation' 1,2,3-triazole-based inhibitors of Porphyromonas gingivalis adherence to oral streptococci and biofilm formation., 10 (2): [PMID:30881614 ] [10.1039/C8MD00405F ]