1'-[[5-chloro-1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]methyl]spiro[cyclopropane-1,3'-pyrrolo[2,3-c]pyridine]-2'-one

ID: ALA4546731

PubChem CID: 117889394

Max Phase: Preclinical

Molecular Formula: C21H19ClN4O3S

Molecular Weight: 442.93

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1N(Cc2nc3cc(Cl)ccc3n2C2CCS(=O)(=O)C2)c2cnccc2C12CC2

Standard InChI:  InChI=1S/C21H19ClN4O3S/c22-13-1-2-17-16(9-13)24-19(26(17)14-4-8-30(28,29)12-14)11-25-18-10-23-7-3-15(18)21(5-6-21)20(25)27/h1-3,7,9-10,14H,4-6,8,11-12H2

Standard InChI Key:  MLQFMPOIRSVIGF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 35  0  0  0  0  0  0  0  0999 V2000
    4.3790   -8.4361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3831   -7.6189    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6733   -8.0239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1867   -2.2906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7687   -2.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9817   -2.0776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6070   -4.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6058   -5.3058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3139   -5.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3121   -4.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0207   -4.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0255   -5.3013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8055   -5.5497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2829   -4.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7978   -4.2252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1001   -4.8798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5045   -4.1697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1676   -3.4239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4817   -3.2779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3155   -4.0756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9226   -4.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6961   -4.3608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8590   -3.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2507   -3.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3673   -3.2585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8000   -6.3642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8992   -4.0778    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.1368   -6.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1977   -7.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4545   -6.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  1  0
  6  5  1  0
  4  6  1  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
 14 16  1  0
 16 17  1  0
 17 20  1  0
 19  5  1  0
  5 18  1  0
 18 17  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 18 25  2  0
 13 26  1  0
  7 27  1  0
 26 28  1  0
 28  2  1  0
  2 29  1  0
 29 30  1  0
 30 26  1  0
M  END

Associated Targets(non-human)

Respiratory syncytial virus (3434 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.93Molecular Weight (Monoisotopic): 442.0866AlogP: 3.02#Rotatable Bonds: 3
Polar Surface Area: 85.16Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.76CX LogP: 1.05CX LogD: 1.04
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.62Np Likeness Score: -1.55

References

1. Cockerill GS, Good JAD, Mathews N..  (2019)  State of the Art in Respiratory Syncytial Virus Drug Discovery and Development.,  62  (7): [PMID:30411898] [10.1021/acs.jmedchem.8b01361]

Source