The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-((2-(Dimethylphosphoryl)phenyl)amino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino)-3-ethoxy-N-(piperidin-4-yl)benzamide ID: ALA4546732
PubChem CID: 155552497
Max Phase: Preclinical
Molecular Formula: C28H34N7O3P
Molecular Weight: 547.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cc(C(=O)NC2CCNCC2)ccc1Nc1nc(Nc2ccccc2P(C)(C)=O)c2cc[nH]c2n1
Standard InChI: InChI=1S/C28H34N7O3P/c1-4-38-23-17-18(27(36)31-19-11-14-29-15-12-19)9-10-21(23)33-28-34-25-20(13-16-30-25)26(35-28)32-22-7-5-6-8-24(22)39(2,3)37/h5-10,13,16-17,19,29H,4,11-12,14-15H2,1-3H3,(H,31,36)(H3,30,32,33,34,35)
Standard InChI Key: BWJGNXWLLYXPBF-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
25.4879 -3.7281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4868 -4.5518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1990 -4.9607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9128 -4.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9071 -3.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1972 -3.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3674 -2.5136 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1825 -2.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5177 -3.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6259 -4.9575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6307 -5.7747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9250 -6.1834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9294 -6.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6400 -7.4051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3477 -6.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3398 -6.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0431 -5.7568 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
29.7551 -6.1577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0343 -4.9396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0372 -6.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7746 -4.9598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7740 -5.7811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0631 -6.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0621 -7.0089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7736 -7.4209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4876 -7.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4850 -6.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7740 -8.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0665 -8.6471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4820 -8.6463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4824 -9.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7758 -9.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7743 -10.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4804 -11.0928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1897 -10.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1929 -9.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3563 -5.7781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6477 -6.1851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9409 -5.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
6 5 2 0
6 1 1 0
7 6 1 0
8 7 1 0
9 8 2 0
5 9 1 0
4 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
17 18 1 0
17 19 2 0
17 20 1 0
2 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
31 36 1 0
23 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.60Molecular Weight (Monoisotopic): 547.2461AlogP: 4.57#Rotatable Bonds: 9Polar Surface Area: 133.06Molecular Species: BASEHBA: 8HBD: 5#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.24CX Basic pKa: 9.96CX LogP: 2.49CX LogD: -0.10Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.19Np Likeness Score: -1.08
References 1. Wang R, Chen Y, Zhao X, Yu S, Yang B, Wu T, Guo J, Hao C, Zhao D, Cheng M.. (2019) Design, synthesis and biological evaluation of novel 7H-pyrrolo[2,3-d]pyrimidine derivatives as potential FAK inhibitors and anticancer agents., 183 [PMID:31550660 ] [10.1016/j.ejmech.2019.111716 ]