The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl (E)-6-chloro-3-((2-(2-(3,4-dimethoxyphenyl)acetyl)hydrazineylidene)methyl)-1H-indole-2-carboxylate ID: ALA4546737
PubChem CID: 155552537
Max Phase: Preclinical
Molecular Formula: C22H22ClN3O5
Molecular Weight: 443.89
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1[nH]c2cc(Cl)ccc2c1/C=N/NC(=O)Cc1ccc(OC)c(OC)c1
Standard InChI: InChI=1S/C22H22ClN3O5/c1-4-31-22(28)21-16(15-7-6-14(23)11-17(15)25-21)12-24-26-20(27)10-13-5-8-18(29-2)19(9-13)30-3/h5-9,11-12,25H,4,10H2,1-3H3,(H,26,27)/b24-12+
Standard InChI Key: IIBPHBFOHAZVNF-WYMPLXKRSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
26.6852 -24.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6841 -25.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3921 -25.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3904 -24.3421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0990 -24.7474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0992 -25.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8822 -25.8247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3659 -25.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8818 -24.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9761 -25.9785 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.1831 -25.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5919 -25.8658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5915 -24.4504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4091 -25.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8180 -26.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1341 -23.7155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9333 -23.5454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.1856 -22.7681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9849 -22.5979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2372 -21.8207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5319 -23.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3312 -23.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8744 -23.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6730 -23.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9259 -22.6981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3742 -22.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5776 -22.2624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6237 -21.3115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4224 -21.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7250 -22.5269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2728 -23.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
2 10 1 0
8 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 1 0
9 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
26 28 1 0
28 29 1 0
25 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.89Molecular Weight (Monoisotopic): 443.1248AlogP: 3.71#Rotatable Bonds: 8Polar Surface Area: 102.01Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.97CX Basic pKa: 0.58CX LogP: 3.61CX LogD: 3.61Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: -1.15
References 1. van der Vlag R, Guo H, Hapko U, Eleftheriadis N, Monjas L, Dekker FJ, Hirsch AKH.. (2019) A combinatorial approach for the discovery of drug-like inhibitors of 15-lipoxygenase-1., 174 [PMID:31026746 ] [10.1016/j.ejmech.2019.04.021 ]