The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-fluorophenyl)-N-methyl-5-(3-(1-(pyridin-2-yl)cyclopropylcarbamoyl)phenyl)benzofuran-3-carboxamide ID: ALA4546784
PubChem CID: 59275359
Max Phase: Preclinical
Molecular Formula: C31H24FN3O3
Molecular Weight: 505.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1c(-c2ccc(F)cc2)oc2ccc(-c3cccc(C(=O)NC4(c5ccccn5)CC4)c3)cc12
Standard InChI: InChI=1S/C31H24FN3O3/c1-33-30(37)27-24-18-21(10-13-25(24)38-28(27)19-8-11-23(32)12-9-19)20-5-4-6-22(17-20)29(36)35-31(14-15-31)26-7-2-3-16-34-26/h2-13,16-18H,14-15H2,1H3,(H,33,37)(H,35,36)
Standard InChI Key: JZKYEGPUISOCLD-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
3.9910 -5.0847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5866 -4.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1776 -5.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4637 -3.1532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4626 -3.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1706 -4.3817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8803 -3.9722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8775 -3.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1689 -2.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2957 -3.9700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0041 -4.3775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7111 -3.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0054 -5.1947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4182 -4.3766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1248 -3.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1239 -3.1495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4106 -2.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7069 -3.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8329 -4.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8316 -5.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5389 -5.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5358 -3.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2437 -4.3700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2510 -5.1890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0321 -5.4351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5076 -4.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0202 -4.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3227 -4.7595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7371 -5.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5535 -5.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9565 -4.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5372 -4.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7221 -4.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2658 -3.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0636 -3.1535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7135 -2.7283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9591 -1.9488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7737 -4.7378 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 2 1 0
2 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 12 1 0
15 19 1 0
19 20 2 0
20 21 1 0
21 24 2 0
23 22 2 0
22 19 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 23 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
26 28 1 0
27 34 1 0
34 35 2 0
34 36 1 0
36 37 1 0
31 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.55Molecular Weight (Monoisotopic): 505.1802AlogP: 6.08#Rotatable Bonds: 6Polar Surface Area: 84.23Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.21CX Basic pKa: 3.95CX LogP: 4.92CX LogD: 4.92Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.29Np Likeness Score: -0.85
References 1. Yeung KS, Beno BR, Mosure K, Zhu J, Grant-Young KA, Parcella K, Anjanappa P, Bora RO, Selvakumar K, Wang YK, Fang H, Krause R, Rigat K, Liu M, Lemm J, Sheriff S, Witmer M, Tredup J, Jardel A, Kish K, Parker D, Haskell R, Santone K, Meanwell NA, Soars MG, Roberts SB, Kadow JF.. (2018) Structure-Property Basis for Solving Transporter-Mediated Efflux and Pan-Genotypic Inhibition in HCV NS5B Inhibitors., 9 (12): [PMID:30613329 ] [10.1021/acsmedchemlett.8b00379 ]