(2R,4S)-4-methoxy-1-((1-(4-(4-methyl-1H-pyrazol-1-yl)pyridin-3-yl)piperidine-4-yl)carbonyl)pyrrolidine-2-carbonitrile

ID: ALA4546835

PubChem CID: 118450494

Max Phase: Preclinical

Molecular Formula: C21H26N6O2

Molecular Weight: 394.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CO[C@H]1C[C@H](C#N)N(C(=O)C2CCN(c3cnccc3-n3cc(C)cn3)CC2)C1

Standard InChI:  InChI=1S/C21H26N6O2/c1-15-11-24-27(13-15)19-3-6-23-12-20(19)25-7-4-16(5-8-25)21(28)26-14-18(29-2)9-17(26)10-22/h3,6,11-13,16-18H,4-5,7-9,14H2,1-2H3/t17-,18+/m1/s1

Standard InChI Key:  HGTAHMVJRPNHOA-MSOLQXFVSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   17.0578   -6.9461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3302   -8.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2481   -9.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7539   -9.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0401   -9.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7529  -10.6982    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0438  -10.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4579   -9.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4579  -10.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0438  -11.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7529  -11.5196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4579  -11.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4579  -12.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7529  -13.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0438  -12.7495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2139  -10.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1629  -11.5196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9267  -11.8209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4456  -11.1897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9999  -10.5012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2991   -9.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7504   -8.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4584   -7.8317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0430   -7.8307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8707   -7.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7201   -7.6857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1691   -9.8746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6515   -6.2371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0624   -5.5307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  1
  6  7  1  0
  7  5  1  0
  5  4  1  0
  4  8  1  0
  8  9  1  0
  6  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 16 20  2  0
 12 17  1  0
  6 11  1  0
 20 21  1  0
  4 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 25  1  1  0
  1 26  1  0
 26  2  1  0
  2 24  1  0
  3 27  3  0
  1 28  1  6
 28 29  1  0
M  END

Associated Targets(Human)

CYP46A1 Tchem Cholesterol 24-hydroxylase (289 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 394.48Molecular Weight (Monoisotopic): 394.2117AlogP: 1.93#Rotatable Bonds: 4
Polar Surface Area: 87.28Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.45CX LogP: 0.83CX LogD: 0.55
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.79Np Likeness Score: -1.30

References

1.  (2017)  Heterocyclic compounds having cholesterol 24-hydroxylase activity, 

Source