4-(2-Cyclohexylacetyl)-1-[(4-methoxyphenyl)aminothiocarbonyl]-2-methylpiperazine

ID: ALA4546854

PubChem CID: 155552679

Max Phase: Preclinical

Molecular Formula: C21H31N3O2S

Molecular Weight: 389.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(NC(=S)N2CCN(C(=O)CC3CCCCC3)CC2C)cc1

Standard InChI:  InChI=1S/C21H31N3O2S/c1-16-15-23(20(25)14-17-6-4-3-5-7-17)12-13-24(16)21(27)22-18-8-10-19(26-2)11-9-18/h8-11,16-17H,3-7,12-15H2,1-2H3,(H,22,27)

Standard InChI Key:  TXMVFCKYWXZKAT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   33.4990  -18.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4979  -19.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2059  -19.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9156  -19.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9127  -18.4062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2041  -18.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7912  -18.0014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0836  -18.4101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0838  -19.2273    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.3758  -18.0017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3740  -17.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6703  -16.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9602  -17.1765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9585  -17.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6667  -18.4075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0817  -16.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2540  -16.7654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2569  -15.9482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5448  -17.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8386  -16.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8393  -15.9464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1372  -15.5354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4256  -15.9380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4208  -16.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1274  -17.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6239  -19.6363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6252  -20.4535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 10 15  1  0
 11 16  1  0
 13 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
  4 26  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4546854

    ---

Associated Targets(non-human)

Human adenovirus 5 (897 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 389.57Molecular Weight (Monoisotopic): 389.2137AlogP: 3.90#Rotatable Bonds: 4
Polar Surface Area: 44.81Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.98CX Basic pKa: CX LogP: 3.85CX LogD: 3.85
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.79Np Likeness Score: -1.39

References

1. Mazzotta S, Marrugal-Lorenzo JA, Vega-Holm M, Serna-Gallego A, Álvarez-Vidal J, Berastegui-Cabrera J, Pérez Del Palacio J, Díaz C, Aiello F, Pachón J, Iglesias-Guerra F, Vega-Pérez JM, Sánchez-Céspedes J..  (2020)  Optimization of piperazine-derived ureas privileged structures for effective antiadenovirus agents.,  185  [PMID:31711794] [10.1016/j.ejmech.2019.111840]

Source