N-(4-morpholinophenyl)-4-phenoxy-5-(pyridin-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine

ID: ALA4546936

PubChem CID: 155552682

Max Phase: Preclinical

Molecular Formula: C27H24N6O2

Molecular Weight: 464.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  c1ccc(Oc2nc(Nc3ccc(N4CCOCC4)cc3)nc3[nH]cc(-c4ccncc4)c23)cc1

Standard InChI:  InChI=1S/C27H24N6O2/c1-2-4-22(5-3-1)35-26-24-23(19-10-12-28-13-11-19)18-29-25(24)31-27(32-26)30-20-6-8-21(9-7-20)33-14-16-34-17-15-33/h1-13,18H,14-17H2,(H2,29,30,31,32)

Standard InChI Key:  SFZCOBFSRLCANY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
    6.2348   -9.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2337  -10.4442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9417  -10.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9399   -9.2158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6486   -9.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6533  -10.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4334  -10.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9107  -10.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4256   -9.3636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5270   -9.2162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8194   -9.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1117   -9.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4046   -9.6229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4043  -10.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1171  -10.8492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8213  -10.4388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6973  -10.8507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9428  -11.6704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2356  -12.0799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9905  -10.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2855  -10.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2826  -11.6628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9908  -12.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7019  -11.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5306  -11.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8239  -12.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8245  -12.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5377  -13.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2415  -12.8948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6891  -11.4593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1441  -12.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4006  -12.8448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2017  -13.0106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7458  -12.3953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4864  -11.6225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
  3 18  1  0
 18 19  1  0
 17 20  1  0
 17 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 19 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 19  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
  7 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4546936

    ---

Associated Targets(Human)

ITK Tclin Tyrosine-protein kinase ITK/TSK (3699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.53Molecular Weight (Monoisotopic): 464.1961AlogP: 5.39#Rotatable Bonds: 6
Polar Surface Area: 88.19Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.25CX Basic pKa: 4.90CX LogP: 5.05CX LogD: 5.05
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -1.23

References

1. Tang G, Liu L, Wang X, Pan Z..  (2019)  Discovery of 7H-pyrrolo[2,3-d]pyrimidine derivatives as selective covalent irreversible inhibitors of interleukin-2-inducible T-cell kinase (Itk).,  173  [PMID:30999237] [10.1016/j.ejmech.2019.03.055]

Source