3-((7-(Aminomethyl)imidazo[1,2-a]pyrimidin-5-yl)amino)-N-phenylbenzamide

ID: ALA4546958

PubChem CID: 134330602

Max Phase: Preclinical

Molecular Formula: C20H18N6O

Molecular Weight: 358.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCc1cc(Nc2cccc(C(=O)Nc3ccccc3)c2)n2ccnc2n1

Standard InChI:  InChI=1S/C20H18N6O/c21-13-17-12-18(26-10-9-22-20(26)25-17)23-16-8-4-5-14(11-16)19(27)24-15-6-2-1-3-7-15/h1-12,23H,13,21H2,(H,24,27)

Standard InChI Key:  MIXNDBUHXTXJSA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   13.1056   -5.4660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3961   -5.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3974   -6.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1076   -7.1023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8130   -5.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8170   -6.6867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2227   -5.8641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5136   -5.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5085   -4.6402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9292   -5.4535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6353   -5.8642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3414   -5.4543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3395   -4.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6256   -4.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9225   -4.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6879   -5.4683    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6871   -4.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3927   -4.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3922   -3.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6836   -3.0193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0997   -3.0190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8077   -3.4272    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9779   -4.2481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9749   -3.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2027   -3.1895    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7284   -3.8474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2076   -4.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  1  1  0
  5  6  2  0
  5  8  1  0
  7  8  1  0
  8  9  2  0
  7 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  2 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 24  1  0
 23 17  1  0
 19 21  1  0
 21 22  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4546958

    ---

Associated Targets(Human)

LOXL2 Tchem Lysyl oxidase homolog 2 (834 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 358.41Molecular Weight (Monoisotopic): 358.1542AlogP: 3.18#Rotatable Bonds: 5
Polar Surface Area: 97.34Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.19CX LogP: 1.64CX LogD: 0.79
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.51Np Likeness Score: -1.78

References

1.  (2018)  Lysyl oxidase-like 2 inhibitors and uses thereof, 

Source