The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(N-ethylacetamido)-2-(4-fluorophenyl)-5-(4-methoxy-3-((1-(pyrimidin-2-yl)cyclopropyl)carbamoyl)phenyl)-N-methylbenzofuran-3-carboxamide ID: ALA4546966
PubChem CID: 155552218
Max Phase: Preclinical
Molecular Formula: C35H32FN5O5
Molecular Weight: 621.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(C(C)=O)c1cc2oc(-c3ccc(F)cc3)c(C(=O)NC)c2cc1-c1ccc(OC)c(C(=O)NC2(c3ncccn3)CC2)c1
Standard InChI: InChI=1S/C35H32FN5O5/c1-5-41(20(2)42)27-19-29-25(30(33(44)37-3)31(46-29)21-7-10-23(36)11-8-21)18-24(27)22-9-12-28(45-4)26(17-22)32(43)40-35(13-14-35)34-38-15-6-16-39-34/h6-12,15-19H,5,13-14H2,1-4H3,(H,37,44)(H,40,43)
Standard InChI Key: JLTMTIKOPCSSMO-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
16.7565 -16.7772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3521 -16.0714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9431 -16.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2293 -14.8456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2281 -15.6651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9362 -16.0741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6458 -15.6647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6430 -14.8420 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9344 -14.4367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0612 -15.6624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7696 -16.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4767 -15.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7709 -16.8871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1837 -16.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8903 -15.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8895 -14.8420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1761 -14.4347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4725 -14.8460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5984 -16.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5971 -16.8856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3044 -17.2933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3013 -15.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0092 -16.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0165 -16.8814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7977 -17.1275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2731 -16.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7858 -15.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0883 -16.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5026 -17.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3190 -17.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7220 -16.4387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3027 -15.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4877 -15.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0313 -15.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8291 -14.8460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4790 -14.4207 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7246 -13.6413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5392 -16.4302 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.8892 -17.2938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1817 -16.8849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4738 -17.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7626 -14.4412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7583 -13.6240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8888 -18.1110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1809 -18.5193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5964 -18.5199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 2 1 0
2 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 12 1 0
15 19 1 0
19 20 2 0
20 21 1 0
21 24 2 0
23 22 2 0
22 19 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 23 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
26 28 1 0
27 34 1 0
34 35 2 0
34 36 1 0
36 37 1 0
31 38 1 0
20 39 1 0
39 40 1 0
40 41 1 0
18 42 1 0
42 43 1 0
39 44 1 0
44 45 2 0
44 46 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 621.67Molecular Weight (Monoisotopic): 621.2387AlogP: 5.86#Rotatable Bonds: 9Polar Surface Area: 126.66Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.13CX Basic pKa: 1.11CX LogP: 3.67CX LogD: 3.67Aromatic Rings: 5Heavy Atoms: 46QED Weighted: 0.21Np Likeness Score: -0.78
References 1. Yeung KS, Beno BR, Mosure K, Zhu J, Grant-Young KA, Parcella K, Anjanappa P, Bora RO, Selvakumar K, Wang YK, Fang H, Krause R, Rigat K, Liu M, Lemm J, Sheriff S, Witmer M, Tredup J, Jardel A, Kish K, Parker D, Haskell R, Santone K, Meanwell NA, Soars MG, Roberts SB, Kadow JF.. (2018) Structure-Property Basis for Solving Transporter-Mediated Efflux and Pan-Genotypic Inhibition in HCV NS5B Inhibitors., 9 (12): [PMID:30613329 ] [10.1021/acsmedchemlett.8b00379 ]