The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
14-O-(((4-amino-1H-pyrrolo[2,3-d]pyrimidin-6-yl)thio)acetyl)mutilin ID: ALA4546981
PubChem CID: 155552302
Max Phase: Preclinical
Molecular Formula: C28H38N4O4S
Molecular Weight: 526.70
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C[C@]1(C)C[C@@H](OC(=O)CSc2nc(N)c3cc[nH]c3n2)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O
Standard InChI: InChI=1S/C28H38N4O4S/c1-6-26(4)13-19(36-20(34)14-37-25-31-23(29)17-9-12-30-24(17)32-25)27(5)15(2)7-10-28(16(3)22(26)35)11-8-18(33)21(27)28/h6,9,12,15-16,19,21-22,35H,1,7-8,10-11,13-14H2,2-5H3,(H3,29,30,31,32)/t15-,16+,19-,21+,22+,26-,27+,28+/m1/s1
Standard InChI Key: UPLWHPJVMATMGH-JOGWJQRPSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
8.5888 -3.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5929 -4.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2985 -4.1608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7881 -4.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1636 -5.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1636 -5.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5929 -6.5151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7881 -6.5151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2174 -5.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2174 -5.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9408 -7.2103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5169 -6.3394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2804 -6.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4785 -7.1814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7704 -7.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1430 -7.7014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7687 -7.5858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8070 -5.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5045 -5.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5045 -4.7298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5029 -3.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7945 -3.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2099 -3.5027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0875 -3.9153 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.3790 -3.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2944 -3.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9180 -4.8255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9186 -6.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9986 -5.7203 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.3803 -2.6939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6726 -2.2867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6771 -3.9216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9689 -3.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9629 -2.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1769 -2.4447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6972 -3.1153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1867 -3.7786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6732 -1.4696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 6
4 2 1 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 4 1 0
7 11 1 1
9 12 1 0
12 13 1 0
13 11 1 0
8 14 1 0
7 15 1 0
14 16 1 0
15 16 1 0
14 17 2 0
12 18 1 1
9 19 1 6
10 20 1 6
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 1 0
1 26 2 0
5 27 1 1
6 28 1 6
8 29 1 6
25 30 2 0
30 31 1 0
31 34 2 0
33 32 2 0
32 25 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 33 1 0
31 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.70Molecular Weight (Monoisotopic): 526.2614AlogP: 4.54#Rotatable Bonds: 5Polar Surface Area: 131.19Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.41CX Basic pKa: 6.94CX LogP: 4.39CX LogD: 4.26Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.22Np Likeness Score: 1.23
References 1. Deng Y, Wang XZ, Huang SH, Li CH.. (2019) Antibacterial activity evaluation of synthetic novel pleuromutilin derivatives in vitro and in experimental infection mice., 162 [PMID:30445267 ] [10.1016/j.ejmech.2018.11.006 ]