The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N2-((1r,4r)-4-aminocyclohexyl)-9-cyclopentyl-N6-(6-(furan-3-yl)pyridin-3-yl)-9H-purine-2,6-diamine ID: ALA4547030
PubChem CID: 155552580
Max Phase: Preclinical
Molecular Formula: C25H30N8O
Molecular Weight: 458.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N[C@H]1CC[C@H](Nc2nc(Nc3ccc(-c4ccoc4)nc3)c3ncn(C4CCCC4)c3n2)CC1
Standard InChI: InChI=1S/C25H30N8O/c26-17-5-7-18(8-6-17)30-25-31-23(22-24(32-25)33(15-28-22)20-3-1-2-4-20)29-19-9-10-21(27-13-19)16-11-12-34-14-16/h9-15,17-18,20H,1-8,26H2,(H2,29,30,31,32)/t17-,18-
Standard InChI Key: PYGTZVRFDCFIIR-IYARVYRRSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
13.2442 -21.7956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2431 -22.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9579 -23.0358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9562 -21.3828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6715 -21.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6717 -22.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4579 -22.8736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9435 -22.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4575 -21.5364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7134 -23.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2287 -24.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7139 -24.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4984 -24.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4981 -23.9122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5284 -23.0349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8142 -22.6218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9537 -20.5578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6669 -20.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3805 -20.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0932 -20.1421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0912 -19.3162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3705 -18.9060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6606 -19.3223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8142 -21.7926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1042 -21.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3870 -21.7880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3844 -22.6141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0990 -23.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6745 -21.3723 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8001 -18.8981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5558 -19.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1009 -18.6066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6827 -17.8977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8793 -18.0763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
7 10 1 0
2 15 1 0
16 15 1 6
4 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
16 24 1 0
16 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 1
21 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.57Molecular Weight (Monoisotopic): 458.2543AlogP: 5.02#Rotatable Bonds: 6Polar Surface Area: 119.71Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.00CX Basic pKa: 10.45CX LogP: 3.73CX LogD: 0.99Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -0.91
References 1. Řezníčková E, Gucký T, Kováčová V, Ajani H, Jorda R, Kryštof V.. (2019) Activity of 2,6,9-trisubstituted purines as potent PDGFRα kinase inhibitors with antileukaemic activity., 182 [PMID:31514019 ] [10.1016/j.ejmech.2019.111663 ]