2-{4-[(1R)-1-[(4-chloro-1,6-dimethyl-1H-indol-2-yl)formamido]ethyl]benzenesulfonyl}pentanoic acid

ID: ALA4547034

PubChem CID: 142427905

Max Phase: Preclinical

Molecular Formula: C24H27ClN2O5S

Molecular Weight: 491.01

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(C(=O)O)S(=O)(=O)c1ccc([C@@H](C)NC(=O)c2cc3c(Cl)cc(C)cc3n2C)cc1

Standard InChI:  InChI=1S/C24H27ClN2O5S/c1-5-6-22(24(29)30)33(31,32)17-9-7-16(8-10-17)15(3)26-23(28)21-13-18-19(25)11-14(2)12-20(18)27(21)4/h7-13,15,22H,5-6H2,1-4H3,(H,26,28)(H,29,30)/t15-,22?/m1/s1

Standard InChI Key:  QMYNFWNAWHISRX-JGHKVMFLSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   20.4999   -6.1372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6786   -6.9626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6828   -6.1454    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.9730   -6.5505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3213   -3.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3201   -4.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0282   -4.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0264   -3.2396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7350   -3.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7398   -4.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5198   -4.7119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9972   -4.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5121   -3.3874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8144   -4.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2271   -4.7472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2188   -3.3318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0360   -3.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4404   -2.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4487   -4.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0414   -4.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4535   -5.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2715   -5.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6757   -4.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2613   -4.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7769   -5.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0239   -2.4224    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.6121   -4.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9157   -6.8407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7328   -6.8325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5142   -7.5525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9014   -5.4254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4856   -4.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8871   -4.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  2  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 12 14  1  0
 14 15  2  0
 14 16  1  0
 17 16  1  6
 17 18  1  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22  3  1  0
  3  1  1  0
 11 25  1  0
  8 26  1  0
  6 27  1  0
  1 28  1  0
 28 29  1  0
 28 30  2  0
  1 31  1  0
 31 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4547034

    ---

Associated Targets(Human)

PHGDH Tchem D-3-phosphoglycerate dehydrogenase (883 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.01Molecular Weight (Monoisotopic): 490.1329AlogP: 4.66#Rotatable Bonds: 8
Polar Surface Area: 105.47Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.47CX Basic pKa: CX LogP: 4.86CX LogD: 1.47
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -1.13

References

1.  (2018)  Tosylacetate based compounds and derivatives thereof as phgdh inhibitors, 

Source