The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{4-[(1R)-1-[(4-chloro-1,6-dimethyl-1H-indol-2-yl)formamido]ethyl]benzenesulfonyl}pentanoic acid ID: ALA4547034
PubChem CID: 142427905
Max Phase: Preclinical
Molecular Formula: C24H27ClN2O5S
Molecular Weight: 491.01
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(C(=O)O)S(=O)(=O)c1ccc([C@@H](C)NC(=O)c2cc3c(Cl)cc(C)cc3n2C)cc1
Standard InChI: InChI=1S/C24H27ClN2O5S/c1-5-6-22(24(29)30)33(31,32)17-9-7-16(8-10-17)15(3)26-23(28)21-13-18-19(25)11-14(2)12-20(18)27(21)4/h7-13,15,22H,5-6H2,1-4H3,(H,26,28)(H,29,30)/t15-,22?/m1/s1
Standard InChI Key: QMYNFWNAWHISRX-JGHKVMFLSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
20.4999 -6.1372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6786 -6.9626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6828 -6.1454 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.9730 -6.5505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3213 -3.6484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3201 -4.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0282 -4.8769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0264 -3.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7350 -3.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7398 -4.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5198 -4.7119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9972 -4.0468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5121 -3.3874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8144 -4.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2271 -4.7472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2188 -3.3318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0360 -3.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4404 -2.6169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4487 -4.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0414 -4.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4535 -5.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2715 -5.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6757 -4.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2613 -4.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7769 -5.4876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0239 -2.4224 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.6121 -4.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9157 -6.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7328 -6.8325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5142 -7.5525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9014 -5.4254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4856 -4.7218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8871 -4.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 2 0
5 6 2 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 9 1 0
12 14 1 0
14 15 2 0
14 16 1 0
17 16 1 6
17 18 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 3 1 0
3 1 1 0
11 25 1 0
8 26 1 0
6 27 1 0
1 28 1 0
28 29 1 0
28 30 2 0
1 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.01Molecular Weight (Monoisotopic): 490.1329AlogP: 4.66#Rotatable Bonds: 8Polar Surface Area: 105.47Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.47CX Basic pKa: ┄CX LogP: 4.86CX LogD: 1.47Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -1.13
References 1. (2018) Tosylacetate based compounds and derivatives thereof as phgdh inhibitors,