The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{(1R,2R,3S,4R)-4-[(4-{[(1S)-2,3-dihydro-1H-inden-1-yl]amino}-6-methyl-1,3,5-triaziny)amino]-2,3-dihydroxycyclopentyl}methyl sulfamate ID: ALA4547043
PubChem CID: 155552613
Max Phase: Preclinical
Molecular Formula: C19H28N6O5S
Molecular Weight: 452.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=NC(N[C@H]2CCc3ccccc32)=NCN1N[C@@H]1C[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C19H28N6O5S/c1-11-22-19(23-15-7-6-12-4-2-3-5-14(12)15)21-10-25(11)24-16-8-13(17(26)18(16)27)9-30-31(20,28)29/h2-5,13,15-18,24,26-27H,6-10H2,1H3,(H,21,23)(H2,20,28,29)/t13-,15+,16-,17-,18+/m1/s1
Standard InChI Key: FLLFSBMBOFWJMN-DEORAPPZSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
27.4614 -11.1995 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.6047 -10.3945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3738 -10.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5136 -9.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9428 -8.7202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1328 -8.8358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3262 -7.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1330 -8.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7220 -7.5677 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2486 -8.9460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0909 -11.7240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7355 -10.8145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7695 -11.6340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9614 -6.3751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6871 -6.7517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3746 -6.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3419 -5.4983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.9193 -5.5577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6170 -5.1176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5846 -4.3010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2756 -3.8648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1173 -2.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3253 -3.0509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5536 -3.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0317 -4.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3133 -4.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1163 -5.0673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6371 -4.4364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3528 -3.6759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0981 -6.6970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9663 -7.2627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 3 1 6
4 5 1 0
5 6 1 1
5 7 1 0
7 8 1 0
8 9 1 6
8 10 1 0
4 10 1 0
1 11 1 0
1 12 2 0
1 13 2 0
15 14 1 0
16 15 1 0
16 17 2 0
19 17 1 0
14 18 1 0
18 19 2 0
19 20 1 0
21 20 1 1
21 25 1 0
24 22 1 0
22 23 1 0
23 21 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
16 30 1 0
15 9 1 0
7 31 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.54Molecular Weight (Monoisotopic): 452.1842AlogP: -0.85#Rotatable Bonds: 6Polar Surface Area: 161.87Molecular Species: BASEHBA: 10HBD: 5#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.40CX Basic pKa: 8.95CX LogP: -1.16CX LogD: -2.68Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.37Np Likeness Score: 0.13
References 1. (2013) Inhibitors of nedd8-activating enzyme,