{(1R,2R,3S,4R)-4-[(4-{[(1S)-2,3-dihydro-1H-inden-1-yl]amino}-6-methyl-1,3,5-triaziny)amino]-2,3-dihydroxycyclopentyl}methyl sulfamate

ID: ALA4547043

PubChem CID: 155552613

Max Phase: Preclinical

Molecular Formula: C19H28N6O5S

Molecular Weight: 452.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1=NC(N[C@H]2CCc3ccccc32)=NCN1N[C@@H]1C[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]1O

Standard InChI:  InChI=1S/C19H28N6O5S/c1-11-22-19(23-15-7-6-12-4-2-3-5-14(12)15)21-10-25(11)24-16-8-13(17(26)18(16)27)9-30-31(20,28)29/h2-5,13,15-18,24,26-27H,6-10H2,1H3,(H,21,23)(H2,20,28,29)/t13-,15+,16-,17-,18+/m1/s1

Standard InChI Key:  FLLFSBMBOFWJMN-DEORAPPZSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   27.4614  -11.1995    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.6047  -10.3945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3738  -10.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5136   -9.3055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9428   -8.7202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1328   -8.8358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3262   -7.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1330   -8.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7220   -7.5677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2486   -8.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0909  -11.7240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7355  -10.8145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7695  -11.6340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.9614   -6.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6871   -6.7517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.3746   -6.3170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3419   -5.4983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.9193   -5.5577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.6170   -5.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5846   -4.3010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2756   -3.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1173   -2.8494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3253   -3.0509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5536   -3.5404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0317   -4.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3133   -4.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1163   -5.0673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6371   -4.4364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3528   -3.6759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0981   -6.6970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9663   -7.2627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  6
  4  5  1  0
  5  6  1  1
  5  7  1  0
  7  8  1  0
  8  9  1  6
  8 10  1  0
  4 10  1  0
  1 11  1  0
  1 12  2  0
  1 13  2  0
 15 14  1  0
 16 15  1  0
 16 17  2  0
 19 17  1  0
 14 18  1  0
 18 19  2  0
 19 20  1  0
 21 20  1  1
 21 25  1  0
 24 22  1  0
 22 23  1  0
 23 21  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 16 30  1  0
 15  9  1  0
  7 31  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4547043

    ---

Associated Targets(Human)

UBA3 Tchem NEDD8 activating enzyme (447 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.54Molecular Weight (Monoisotopic): 452.1842AlogP: -0.85#Rotatable Bonds: 6
Polar Surface Area: 161.87Molecular Species: BASEHBA: 10HBD: 5
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.40CX Basic pKa: 8.95CX LogP: -1.16CX LogD: -2.68
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.37Np Likeness Score: 0.13

References

1.  (2013)  Inhibitors of nedd8-activating enzyme, 

Source