The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(4-((3,7-Dimethylocta-2,6-dien-1-yl)oxy)-3-methoxyphenyl)-3-(3-methoxy-4-((3-methylbut-2-en-1-yl)oxy)phenyl)prop-2-en-1-one ID: ALA4547047
PubChem CID: 155552615
Max Phase: Preclinical
Molecular Formula: C32H40O5
Molecular Weight: 504.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)c2ccc(OC/C=C(\C)CCC=C(C)C)c(OC)c2)ccc1OCC=C(C)C
Standard InChI: InChI=1S/C32H40O5/c1-23(2)9-8-10-25(5)18-20-37-30-16-13-27(22-32(30)35-7)28(33)14-11-26-12-15-29(31(21-26)34-6)36-19-17-24(3)4/h9,11-18,21-22H,8,10,19-20H2,1-7H3/b14-11+,25-18+
Standard InChI Key: DBSPPKSTAOJNQC-IDXNFREDSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
29.5965 -21.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3042 -20.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0120 -21.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3042 -19.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7197 -20.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4274 -21.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1351 -20.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8428 -21.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1351 -19.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5505 -20.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2582 -21.1951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.3373 -21.1688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.3348 -21.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0412 -22.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0388 -23.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7452 -23.6246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3298 -23.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9211 -21.1748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2154 -20.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9674 -19.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9662 -20.7870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6743 -21.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3839 -20.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3811 -19.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6725 -19.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0873 -19.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7965 -19.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0842 -18.7354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5027 -19.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2119 -19.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6275 -20.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6217 -19.9424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9128 -19.5403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3264 -19.5287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.0371 -19.9321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2596 -19.5591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2594 -18.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
8 10 1 0
10 11 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
15 17 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
24 26 1 0
26 27 1 0
26 28 2 0
27 29 2 0
29 30 1 0
30 19 2 0
19 18 1 0
18 31 2 0
31 32 1 0
32 33 2 0
33 30 1 0
21 11 1 0
31 12 1 0
32 34 1 0
34 35 1 0
20 36 1 0
36 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.67Molecular Weight (Monoisotopic): 504.2876AlogP: 8.02#Rotatable Bonds: 14Polar Surface Area: 53.99Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.64CX LogD: 7.64Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.15Np Likeness Score: 0.74
References 1. Espinoza-Hicks JC, Chacón-Vargas KF, Hernández-Rivera JL, Nogueda-Torres B, Tamariz J, Sánchez-Torres LE, Camacho-Dávila A.. (2019) Novel prenyloxy chalcones as potential leishmanicidal and trypanocidal agents: Design, synthesis and evaluation., 167 [PMID:30784876 ] [10.1016/j.ejmech.2019.02.028 ]