1-(4-(4-methyl-1H-pyrazol-1-yl)pyridin-3-yl)-N-phenylpiperidine-4-carboxamide

ID: ALA4547069

PubChem CID: 118450436

Max Phase: Preclinical

Molecular Formula: C21H23N5O

Molecular Weight: 361.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cnn(-c2ccncc2N2CCC(C(=O)Nc3ccccc3)CC2)c1

Standard InChI:  InChI=1S/C21H23N5O/c1-16-13-23-26(15-16)19-7-10-22-14-20(19)25-11-8-17(9-12-25)21(27)24-18-5-3-2-4-6-18/h2-7,10,13-15,17H,8-9,11-12H2,1H3,(H,24,27)

Standard InChI Key:  ZLNJKBZGWZGIQG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    6.8842   -6.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5929   -7.6771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8879   -7.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5929   -6.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3020   -6.4513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3020   -7.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5929   -5.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3020   -4.8128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8879   -8.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5929   -8.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3020   -8.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3020   -9.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5929  -10.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8879   -9.7201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0951   -7.6798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0111   -8.4943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7543   -8.8246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3021   -8.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8935   -7.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2257   -6.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8854   -4.8125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8857   -3.9953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5965   -3.5903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5972   -2.7738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8891   -2.3641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1789   -2.7768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1817   -3.5919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  1  0
  1  4  1  0
  4  5  1  0
  5  6  1  0
  2  6  1  0
  7  8  2  0
  4  7  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 15 19  2  0
 11 16  1  0
  2 10  1  0
 19 20  1  0
  7 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
M  END

Associated Targets(Human)

CYP46A1 Tchem Cholesterol 24-hydroxylase (289 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 361.45Molecular Weight (Monoisotopic): 361.1903AlogP: 3.43#Rotatable Bonds: 4
Polar Surface Area: 63.05Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.45CX LogP: 2.97CX LogD: 2.69
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.77Np Likeness Score: -1.95

References

1.  (2017)  Heterocyclic compounds having cholesterol 24-hydroxylase activity, 

Source