The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3-amino-1-cyano-3-oxopropyl)-3-(4-(6-tert-butylpyridin-3-yl)phenylsulfonyl)-2,2-dimethylpropanamide ID: ALA4547118
PubChem CID: 155552502
Max Phase: Preclinical
Molecular Formula: C24H30N4O4S
Molecular Weight: 470.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(CS(=O)(=O)c1ccc(-c2ccc(C(C)(C)C)nc2)cc1)C(=O)N[C@H](C#N)CC(N)=O
Standard InChI: InChI=1S/C24H30N4O4S/c1-23(2,3)20-11-8-17(14-27-20)16-6-9-19(10-7-16)33(31,32)15-24(4,5)22(30)28-18(13-25)12-21(26)29/h6-11,14,18H,12,15H2,1-5H3,(H2,26,29)(H,28,30)/t18-/m0/s1
Standard InChI Key: XKEUBOPSBXBIEK-SFHVURJKSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
27.3759 -25.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5475 -24.6354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9603 -25.3453 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.3687 -24.6329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7284 -26.9962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7273 -27.8157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4353 -28.2247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1450 -27.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1422 -26.9926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4336 -26.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8453 -26.5826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5548 -26.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2605 -26.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2579 -25.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5437 -25.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8409 -25.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6733 -25.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0887 -25.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0909 -26.5677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7953 -25.3400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5041 -25.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3717 -24.5240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0817 -24.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2107 -25.3361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9122 -24.9245 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5063 -26.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2152 -26.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2174 -27.7877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9218 -26.5600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0193 -28.2237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3119 -27.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0186 -29.0409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3060 -28.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 11 1 0
14 3 1 0
3 17 1 0
17 1 1 0
1 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
1 22 1 0
1 23 1 0
21 24 1 0
24 25 3 0
21 26 1 6
26 27 1 0
27 28 1 0
27 29 2 0
6 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.60Molecular Weight (Monoisotopic): 470.1988AlogP: 2.73#Rotatable Bonds: 8Polar Surface Area: 143.01Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.31CX Basic pKa: 4.83CX LogP: 2.21CX LogD: 2.21Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.61Np Likeness Score: -1.05
References 1. Eddie SL, Gregson A, Graham E, Burton S, Harrison T, Burden R, Scott CJ, Mullan PB, Williams R.. (2019) Identification and SAR exploration of a novel series of Legumain inhibitors., 29 (12): [PMID:31005445 ] [10.1016/j.bmcl.2019.03.019 ]