Benwamycin H

ID: ALA4547130

PubChem CID: 38354501

Max Phase: Preclinical

Molecular Formula: C20H28O4

Molecular Weight: 332.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC(=O)O[C@@H]([C@H](C)C(C)=O)[C@@H](C)c1ccc(C)cc1/C=C/CO

Standard InChI:  InChI=1S/C20H28O4/c1-6-19(23)24-20(14(3)16(5)22)15(4)18-10-9-13(2)12-17(18)8-7-11-21/h7-10,12,14-15,20-21H,6,11H2,1-5H3/b8-7+/t14-,15+,20+/m1/s1

Standard InChI Key:  MIXMRTZVGMGBIC-PHYBXGOISA-N

Molfile:  

 
     RDKit          2D

 24 24  0  0  0  0  0  0  0  0999 V2000
    5.0991   -6.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8112   -6.5192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5154   -6.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5154   -7.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8137   -8.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0991   -7.7506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2234   -8.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8112   -5.6998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5193   -5.2921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5193   -4.4726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2273   -4.0608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3910   -6.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6829   -6.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6829   -7.7459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0906   -8.4540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6829   -9.1662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0906   -9.8742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9100   -8.4540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9748   -6.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2626   -6.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5546   -6.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2626   -7.7459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9748   -5.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3910   -5.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  2  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
  1 12  1  0
 12 13  1  0
 13 14  1  1
 14 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  2  0
 13 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 19 23  1  1
 12 24  1  1
M  END

Associated Targets(non-human)

3T3-L1 (3664 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 332.44Molecular Weight (Monoisotopic): 332.1988AlogP: 3.65#Rotatable Bonds: 8
Polar Surface Area: 63.60Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.00CX LogD: 4.00
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.74Np Likeness Score: 0.91

References

1. Yang FX, Huang JP, Liu Z, Wang Z, Yang J, Tang J, Yu Z, Yan Y, Kai G, Huang SX..  (2020)  Benwamycins A-G, Trialkyl-Substituted Benzene Derivatives from a Soil-Derived Streptomyces.,  83  (1): [PMID:31904958] [10.1021/acs.jnatprod.9b00903]

Source