ethyl 2-(4-{[(4-chloro-1,6-dimethyl-1H-indol-2-yl)formamido]methyl}benzenesulfonyl)acetate

ID: ALA4547209

PubChem CID: 142427791

Max Phase: Preclinical

Molecular Formula: C22H23ClN2O5S

Molecular Weight: 462.96

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)CS(=O)(=O)c1ccc(CNC(=O)c2cc3c(Cl)cc(C)cc3n2C)cc1

Standard InChI:  InChI=1S/C22H23ClN2O5S/c1-4-30-21(26)13-31(28,29)16-7-5-15(6-8-16)12-24-22(27)20-11-17-18(23)9-14(2)10-19(17)25(20)3/h5-11H,4,12-13H2,1-3H3,(H,24,27)

Standard InChI Key:  SQZNDZWUPUZPRU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   13.8912  -10.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1626  -10.3159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4625  -10.7531    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.7339  -10.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7054   -9.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9768   -9.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2808   -9.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5522   -9.2046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8521   -9.6418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1234   -9.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0950   -8.4303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4234   -9.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3658  -10.5100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9982  -11.0431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5674  -10.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1802  -11.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3559  -11.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9187  -10.7685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3057  -10.0400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1302  -10.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6591   -9.3791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8686   -9.3439    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.9688  -12.1973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3092  -10.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0337  -10.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0742  -11.4799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8988  -11.4502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9197  -11.5274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5915  -10.2658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3159  -10.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3484  -11.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  0
 10 11  2  0
 10 12  1  0
 13 12  1  0
 13 14  1  0
 13 15  1  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 20 19  1  0
 20 15  2  0
 21 20  1  0
 12 21  2  0
 19 22  1  0
 17 23  1  0
  7 24  2  0
 24 25  1  0
  4 25  2  0
  3 26  2  0
  3 27  2  0
  1 28  2  0
  1 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4547209

    ---

Associated Targets(Human)

PHGDH Tchem D-3-phosphoglycerate dehydrogenase (883 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.96Molecular Weight (Monoisotopic): 462.1016AlogP: 3.41#Rotatable Bonds: 7
Polar Surface Area: 94.47Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.48CX Basic pKa: CX LogP: 3.41CX LogD: 3.41
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -1.59

References

1.  (2018)  Tosylacetate based compounds and derivatives thereof as phgdh inhibitors, 

Source