The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-ethyl-N-(2-fluoro-3-(trifluoromethyl)phenyl)-3'-(imidazo[1,2-a]pyrazin-3-yl)-5'-methyl-[1,1'-biphenyl]-3-carboxamide ID: ALA4547295
PubChem CID: 155553503
Max Phase: Preclinical
Molecular Formula: C29H22F4N4O
Molecular Weight: 518.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2F)cc1-c1cc(C)cc(-c2cnc3cnccn23)c1
Standard InChI: InChI=1S/C29H22F4N4O/c1-3-18-7-8-19(28(38)36-24-6-4-5-23(27(24)30)29(31,32)33)14-22(18)20-11-17(2)12-21(13-20)25-15-35-26-16-34-9-10-37(25)26/h4-16H,3H2,1-2H3,(H,36,38)
Standard InChI Key: LQBSFUBGTMSCSY-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
31.3614 -22.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3602 -22.9332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0724 -23.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7821 -22.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7793 -22.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0706 -21.6965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4910 -23.3394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4910 -24.1619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2026 -24.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9148 -24.1595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9109 -23.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1987 -22.9303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6206 -22.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3345 -23.3268 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6165 -22.1005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6481 -23.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7612 -24.3306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5647 -24.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3490 -23.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9009 -23.0154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6540 -22.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8548 -22.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3028 -22.6676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5500 -23.4498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0443 -22.9146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7523 -23.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4615 -22.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4578 -22.0908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7389 -21.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0367 -22.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7794 -24.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7798 -25.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1752 -23.3183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1790 -24.1396 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.8852 -22.9064 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.8814 -23.7274 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.0682 -20.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7537 -24.1458 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
4 7 1 0
11 13 1 0
13 14 1 0
13 15 2 0
2 16 1 0
16 20 1 0
19 17 2 0
17 18 1 0
18 16 2 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
14 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
8 31 1 0
31 32 1 0
27 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
6 37 1 0
26 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.51Molecular Weight (Monoisotopic): 518.1730AlogP: 7.34#Rotatable Bonds: 5Polar Surface Area: 59.29Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.91CX LogP: 6.34CX LogD: 6.34Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.44
References 1. Mo C, Zhang Z, Li Y, Huang M, Zou J, Luo J, Tu ZC, Xu Y, Ren X, Ding K, Lu X.. (2020) Design and Optimization of 3'-(Imidazo[1,2-a]pyrazin-3-yl)-[1,1'-biphenyl]-3-carboxamides as Selective DDR1 Inhibitors., 11 (3): [PMID:32184973 ] [10.1021/acsmedchemlett.9b00495 ]