The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-5'-Chloro-2'-((3-fluoro-4-methoxyphenyl)carbamoyl)-4-((2-hydroxy-1-phenylethyl)carbamoyl)[1,1'-biphenyl]-2-carboxylic Acid ID: ALA4547328
PubChem CID: 155553677
Max Phase: Preclinical
Molecular Formula: C30H24ClFN2O6
Molecular Weight: 562.98
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(NC(=O)c2ccc(Cl)cc2-c2ccc(C(=O)N[C@H](CO)c3ccccc3)cc2C(=O)O)cc1F
Standard InChI: InChI=1S/C30H24ClFN2O6/c1-40-27-12-9-20(15-25(27)32)33-29(37)22-11-8-19(31)14-23(22)21-10-7-18(13-24(21)30(38)39)28(36)34-26(16-35)17-5-3-2-4-6-17/h2-15,26,35H,16H2,1H3,(H,33,37)(H,34,36)(H,38,39)/t26-/m1/s1
Standard InChI Key: IJGJKPVCMBPISA-AREMUKBSSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
20.7436 -5.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7424 -6.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4582 -6.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1756 -6.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1727 -5.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4564 -4.8282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0301 -4.8288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0312 -4.0022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3207 -3.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6043 -4.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6072 -4.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3224 -5.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8883 -3.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8869 -2.7676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7470 -3.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4621 -4.0033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7476 -2.7666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8866 -4.8221 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.0266 -6.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3157 -6.0699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0259 -7.3067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5998 -6.4801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8854 -6.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1702 -6.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1691 -7.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8893 -7.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6015 -7.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4539 -7.7176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4553 -6.0645 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.1734 -4.0049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4573 -3.5953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4560 -2.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7425 -4.0071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0264 -3.5976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1742 -2.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1733 -1.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4567 -1.1279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7396 -1.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7440 -2.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4559 -8.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
1 7 1 0
10 13 1 0
13 14 2 0
8 15 1 0
15 16 1 0
15 17 2 0
5 18 1 0
2 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
24 29 1 0
13 30 1 0
31 30 1 0
31 32 1 6
31 33 1 0
33 34 1 0
32 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 32 1 0
28 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.98Molecular Weight (Monoisotopic): 562.1307AlogP: 5.57#Rotatable Bonds: 9Polar Surface Area: 124.96Molecular Species: ACIDHBA: 5HBD: 4#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.44CX Basic pKa: ┄CX LogP: 5.13CX LogD: 1.73Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -1.10
References 1. Su S, Clarke A, Han Y, Chao HJ, Bostwick J, Schumacher W, Wang T, Yan M, Hsu MY, Simmons E, Luk C, Xu C, Dabros M, Galella M, Onorato J, Gordon D, Wexler R, Gargalovic PS, Lawrence RM.. (2019) Biphenyl Acid Derivatives as APJ Receptor Agonists., 62 (22): [PMID:31724863 ] [10.1021/acs.jmedchem.9b01513 ]